Subversion Repositories Scribus

Rev

Rev 21103 | Rev 21125 | Go to most recent revision | Blame | Compare with Previous | Last modification | View Log | RSS feed

/*
For general Scribus (>=1.3.2) copyright and licensing information please refer
to the COPYING file provided with the program. Following this notice may exist
a copyright and/or license notice that predates the release of Scribus 1.3.2
for which a new license (GPL+exception) is in place.
*/

/***************************************************************************
                          scribusview.cpp  -  description
                             -------------------
    begin                : Fre Apr  6 21:47:55 CEST 2001
    copyright            : (C) 2001 by Franz Schmid
    email                : Franz.Schmid@altmuehlnet.de
 ***************************************************************************/


/***************************************************************************
 *                                                                         *
 *   This program is free software; you can redistribute it and/or modify  *
 *   it under the terms of the GNU General Public License as published by  *
 *   the Free Software Foundation; either version 2 of the License, or     *
 *   (at your option) any later version.                                   *
 *                                                                         *
 ***************************************************************************/


#include "scribusview.h"

#include "scconfig.h"
#include "sclimits.h"

#include <QColor>
#include <QDebug>
#include <QDrag>
#include <QDragEnterEvent>
#include <QDragLeaveEvent>
#include <QDragMoveEvent>
#include <QDropEvent>
#include <QEvent>
#include <QFile>
#include <QFileInfo>
#include <QFont>
#include <QFontMetrics>
#include <QImage>
#include <QImageReader>
#include <QLabel>
#include <QList>
#include <QMenu>
#include <QMessageBox>
#include <QMimeData>
#include <QMouseEvent>
#include <QPaintEvent>
#include <QPixmap>
#include <QPolygon>
#include <QStack>
#include <QStringList>
#include <QWheelEvent>
#include <QWidgetAction>
#include <QStyleOptionRubberBand>

#include <cstdio>
#include <cstdlib>

#ifdef HAVE_UNISTD_H
#include <unistd.h>
#endif

#include <QUrl>
#include <QDir>
#include <QSizeGrip>

#include "actionmanager.h"
#include "appmodehelper.h"
#include "appmodes.h"
#include "canvas.h"
#include "canvasgesture.h"
#include "canvasmode.h"
#include "canvasmode_imageimport.h"
#include "canvasmode_objimport.h"
#include "commonstrings.h"
#include "fileloader.h"
#include "filewatcher.h"
#include "hyphenator.h"
#include "iconmanager.h"
#include "loadsaveplugin.h"
#include "text/textlayoutpainter.h"
#include "pageitem.h"
#include "pageitem_group.h"
#include "pageitem_imageframe.h"
#include "pageitem_latexframe.h"
#include "pageitem_line.h"
#include "pageitem_pathtext.h"
#include "pageitem_polygon.h"
#include "pageitem_polyline.h"
#include "pageitem_table.h"
#include "pageitem_textframe.h"
#include "plugins/formatidlist.h"
#include "prefscontext.h"
#include "prefsfile.h"
#include "prefsmanager.h"
#include "scclocale.h"
#include "scmimedata.h"
#include "scpage.h"
#include "scpainter.h"
#include "scpaths.h"
#include "scribusXml.h"
#include "scribuscore.h"
#include "scribuswin.h"
#include "selection.h"
#include "selectionrubberband.h"
#include "serializer.h"
#include "ui/extimageprops.h"
#include "ui/guidemanager.h"
#include "ui/hruler.h"
#include "ui/insertTable.h"
#include "ui/oneclick.h"
#include "ui/pageitemattributes.h"
#include "ui/pageselector.h"
#include "ui/propertiespalette.h"
#include "ui/propertiespalette_image.h"
#include "ui/propertiespalette_line.h"
#include "ui/propertiespalette_text.h"
#include "ui/rulermover.h"
#include "ui/scrapbookpalette.h"
#include "ui/storyeditor.h"
#include "ui/symbolpalette.h"
#include "ui/viewtoolbar.h"
#include "ui/vruler.h"
#include "undomanager.h"
#include "units.h"
#include "util.h"
#include "util_color.h"
#include "util_formats.h"
#include "util_math.h"




using namespace std;

ScribusView::ScribusView(QWidget* win, ScribusMainWindow* mw, ScribusDoc *doc) :
        QScrollArea(win),
        Doc(doc),
        m_canvas(new Canvas(doc, this)),
        Prefs(&(PrefsManager::instance()->appPrefs)),
        undoManager(UndoManager::instance()),
        m_ScMW(mw),
        OldScale(0),
        dragX(0), dragY(0), dragW(0), dragH(0),
        oldW(-1), // oldCp(-1),
        RotMode(0),
        HaveSelRect(false),
        DraggedGroup(false),
        MidButt(false),
        updateOn(true),
        Magnify(false),
        RCenter(-1,-1),
        Ready(false),
        oldX(0), oldY(0),
        m_groupTransactions(0),
        m_oldCanvasHeight(0), m_oldCanvasWidth(0),
        m_groupTransaction(),
        _isGlobalMode(true),
        linkAfterDraw(false),
        ImageAfterDraw(false),
        m_vhRulerHW(17)
{
        setObjectName("s");
        QPalette p=palette();
        p.setBrush(QPalette::Window, PrefsManager::instance()->appPrefs.displayPrefs.scratchColor);
        setPalette(p);
        setAttribute(Qt::WA_StaticContents);
        setAttribute(Qt::WA_InputMethodEnabled, true);
        setHorizontalScrollBarPolicy(Qt::ScrollBarAlwaysOn);
        setVerticalScrollBarPolicy(Qt::ScrollBarAlwaysOn);
        setViewportMargins(m_vhRulerHW, m_vhRulerHW, 0, 0);
        setWidgetResizable(false);
        m_canvasMode = CanvasMode::createForAppMode(this, Doc->appMode);
        setWidget(m_canvas);
        //already done by QScrollArea: widget()->installEventFilter(this);
        installEventFilter(this); // FIXME:av
//      viewport()->setBackgroundMode(Qt::PaletteBackground);
        setFocusPolicy(Qt::ClickFocus);
        QFont fo = QFont(font());
        // #8058: Better not use too small font size on Windows
        // in case ClearType is not enabled
        int posi = fo.pointSize() - (ScCore->isWinGUI() ? 1 : 2);
        fo.setPointSize(posi);
        horizRuler = new Hruler(this, Doc);
        vertRuler = new Vruler(this, Doc);
        horizRuler->installEventFilter(this);
        vertRuler->installEventFilter(this);
        rulerMover = new RulerMover(this);
        rulerMover->setFocusPolicy(Qt::NoFocus);
        horizRuler->setGeometry(m_vhRulerHW, 1, width()-m_vhRulerHW-1, m_vhRulerHW);
        vertRuler->setGeometry(1, m_vhRulerHW, m_vhRulerHW, height()-m_vhRulerHW-1);
        rulerMover->setGeometry(1, 1, m_vhRulerHW, m_vhRulerHW);
        Ready = true;
        m_canvas->setMouseTracking(true);
        setAcceptDrops(true);
        m_canvas->setAcceptDrops(true);
        // FIXME setDragAutoScroll(false);
        Doc->DragP = false;
        Doc->leaveDrag = false;
        Doc->SubMode = -1;
        storedFramesShown = Doc->guidesPrefs().framesShown;
        storedShowControls = Doc->guidesPrefs().showControls;
        setRulersShown(Doc->guidesPrefs().rulersShown);
        m_canvas->m_viewMode.viewAsPreview = false;
        m_canvas->setPreviewVisual(-1);
        m_previousMode = -1;
        redrawMarker = new SelectionRubberBand(QRubberBand::Rectangle, this);
        redrawMarker->hide();
        m_canvas->newRedrawPolygon();
        m_canvas->resetRenderMode();
//  #13101 : "viewPreviewMode" is checked if necessary in ScribusMainWindow::newActWin()
//  At this point the view and parent window may not be able to perform all what is necessary to
//  enable preview mode anyway, especially when loading an existing doc.
//      m_ScMW->scrActions["viewPreviewMode"]->setChecked(m_canvas->m_viewMode.viewAsPreview);
        m_mousePointDoc = FPoint(0,0);
        Doc->regionsChanged()->connectObserver(this);
        connect(this, SIGNAL(HaveSel()), Doc, SLOT(selectionChanged()));
// Commented out to fix bug #7865
//      m_dragTimer = new QTimer(this);
//      connect(m_dragTimer, SIGNAL(timeout()), this, SLOT(dragTimerTimeOut()));
//      m_dragTimer->stop();
        m_dragTimerFired = false;
        clockLabel = new ClockWidget(this, Doc);
        clockLabel->setGeometry(m_vhRulerHW + 1, height() - m_vhRulerHW - 61, 60, 60);
        clockLabel->setVisible(false);
        endEditButton = new QPushButton(IconManager::instance()->loadIcon("22/exit.png"), tr("End Edit"), this);
        endEditButton->setGeometry(m_vhRulerHW + 1, height() - m_vhRulerHW - endEditButton->minimumSizeHint().height() - 1, endEditButton->minimumSizeHint().width(), endEditButton->minimumSizeHint().height());
        endEditButton->setVisible(false);
        connect(endEditButton, SIGNAL(clicked()), m_ScMW, SLOT(slotEndSpecialEdit()));

        m_oldSnapToElem = Doc->SnapElement;
        languageChange();
}

ScribusView::~ScribusView()
{
        while (m_canvasMode)
        {
                m_canvasMode->deactivate(false);
                m_canvasMode = m_canvasMode->delegate();
        }
}

void ScribusView::changeEvent(QEvent *e)
{
        if (e->type() == QEvent::LanguageChange)
        {
                languageChange();
        }
        else
                QWidget::changeEvent(e);
}

void ScribusView::languageChange()
{
        endEditButton->setToolTip( tr("Click here to leave this special edit mode"));
}

void ScribusView::toggleCMS(bool cmsOn)
{
        Doc->enableCMS(cmsOn);
        m_ScMW->requestUpdate(reqCmsOptionsUpdate);
        DrawNew();
}


void ScribusView::switchPreviewVisual(int vis)
{
        m_canvas->setPreviewVisual(vis);
        Doc->viewAsPreview = m_canvas->usePreviewVisual();
        Doc->previewVisual = m_canvas->previewVisual();
        Doc->recalculateColors();
        Doc->recalcPicturesRes();
        DrawNew();
}

void ScribusView::togglePreviewEdit(bool edit)
{
        Doc->editOnPreview = edit;
        m_ScMW->setPreviewToolbar();
        m_EditModeWasOn = true;
        DrawNew();
}

void ScribusView::togglePreview(bool inPreview)
{
        this->requestMode(modeNormal);
        Deselect(true);
        undoManager->setUndoEnabled(false);
        m_canvas->m_viewMode.viewAsPreview = inPreview;
        Doc->drawAsPreview = inPreview;
        bool recalc = false;
        Doc->editOnPreview = false;
        m_ScMW->scrActions["viewEditInPreview"]->setChecked(false);
        m_AnnotChanged = false;
        m_EditModeWasOn = false;
        m_ChangedState = Doc->isModified();

        if (inPreview)
        {
                m_ScMW->scrActions["viewEditInPreview"]->setEnabled(true);
                storedFramesShown = Doc->guidesPrefs().framesShown;
                Doc->guidesPrefs().framesShown = false;
                storedShowControls = Doc->guidesPrefs().showControls;
                Doc->guidesPrefs().showControls = false;
                m_canvas->m_viewMode.previewVisual = 0;
                Doc->previewVisual = 0;
                // warning popping up in case colour management and out-of-gamut-display are active
                // as from #4346: Add a preview for daltonian - PV
                if (Doc->HasCMS && Doc->Gamut)
                        ScMessageBox::information(m_ScMW, tr("Preview Mode"),
                                                "<qt>" + tr("CMS is active. Therefore the color display may not match the perception by visually impaired") + "</qt>");
        }
        else
        {
                if (m_AnnotChanged)
                        Doc->ResetFormFields();
                m_ScMW->scrActions["viewEditInPreview"]->setEnabled(false);
                Doc->guidesPrefs().framesShown = storedFramesShown;
                Doc->guidesPrefs().showControls = storedShowControls;
                m_canvas->m_viewMode.previewVisual = 0;
                Doc->previewVisual = 0;
                if (m_ScMW->viewToolBar->visualMenu->currentIndex() != Doc->previewVisual)
                        recalc = true;
                m_ScMW->viewToolBar->setDoc(Doc);
        }
        m_ScMW->appModeHelper->setPreviewMode(inPreview);
        m_ScMW->setPreviewToolbar();
        m_ScMW->viewToolBar->setViewPreviewMode(inPreview);
        ScGuardedPtr<ScribusDoc> docPtr = Doc->guardedPtr();
        if (recalc)
        {
                Doc->recalculateColors();
                Doc->recalcPicturesRes();
        }
        if (docPtr) // document may have been destroyed in-between
        {
                DrawNew();
                if ((!m_EditModeWasOn) && (!m_AnnotChanged))
                        Doc->setModified(m_ChangedState);
        }
        undoManager->setUndoEnabled(true);
}

void ScribusView::changed(QRectF re, bool)
{
        double scale = m_canvas->scale();
        int newCanvasWidth = qRound((Doc->maxCanvasCoordinate.x() - Doc->minCanvasCoordinate.x()) * scale);
        int newCanvasHeight = qRound((Doc->maxCanvasCoordinate.y() - Doc->minCanvasCoordinate.y()) * scale);
        if (!re.isValid() && // don't check this all the time
                ( m_oldCanvasWidth != newCanvasWidth || m_oldCanvasHeight != newCanvasHeight))
        {
                QSize maxViewport = maximumViewportSize();
                horizontalScrollBar()->setRange(qRound(Doc->minCanvasCoordinate.x() * scale),
                                                                                qRound(Doc->maxCanvasCoordinate.x() * scale) - maxViewport.width());
                verticalScrollBar()->setRange(qRound(Doc->minCanvasCoordinate.y() * scale),
                                                                          qRound(Doc->maxCanvasCoordinate.y() * scale) - maxViewport.height());
                /*      qDebug() << "adjustCanvas [" << m_oldCanvasWidth << m_oldCanvasHeight << " ] -> [" << newCanvasWidth << newCanvasHeight
                                << "] (" << Doc->minCanvasCoordinate.x() << Doc->minCanvasCoordinate.y() << ") - ("
                                << Doc->maxCanvasCoordinate.x() << Doc->maxCanvasCoordinate.y() << ") @" << scale << maxViewport;
                */

                widget()->resize(newCanvasWidth, newCanvasHeight);     
                m_oldCanvasWidth = newCanvasWidth;
                m_oldCanvasHeight = newCanvasHeight;
        }
        if (!Doc->isLoading() && !m_ScMW->scriptIsRunning())
        {
//              qDebug() << "ScribusView-changed(): changed region:" << re;
                m_canvas->setForcedRedraw(true);
                updateCanvas(re);
        }
}

bool ScribusView::handleObjectImport(QMimeData* mimeData, TransactionSettings* trSettings)
{
        requestMode(modeImportObject);
        CanvasMode_ObjImport* objImport = dynamic_cast<CanvasMode_ObjImport*>(m_canvasMode);
        if (objImport)
        {
                objImport->setMimeData(mimeData);
                objImport->setTransactionSettings(trSettings);
                return true;
        }
        delete trSettings;
        delete mimeData;
        return false;
}

void ScribusView::startGesture(CanvasGesture* gesture)
{
        //qDebug() << "start gesture" << typeid(*m_canvasMode).name()
        //              << "---->"
        //              << typeid(*gesture).name();
        if (m_canvasMode != gesture)
        {
                m_canvasMode->deactivate(true);
                gesture->setDelegate(m_canvasMode);
                m_canvasMode = gesture;
                m_canvasMode->activate(false);
                if (Doc->appMode != modeEditClip)
                        m_canvas->repaint();
        }
}

void ScribusView::stopGesture()
{
        //qDebug() << "stop gesture" << typeid(*m_canvasMode).name() << (m_canvasMode->delegate() != 0);
        if (m_canvasMode->delegate())
        {
                m_canvasMode->deactivate(false);
                m_canvasMode = m_canvasMode->delegate();
                m_canvasMode->activate(true);
                if (PrefsManager::instance()->appPrefs.uiPrefs.stickyTools)
                {
                        m_canvas->setForcedRedraw(true);
//                      Doc->m_Selection->clear();
//                      emit HaveSel();
                        m_canvas->resetRenderMode();
                        updateContents();
                }
                else
                        m_canvas->repaint();
        }
}

/**
switches between appmodes:
 - for submodes, activate the appropriate dialog or palette
 - set a new CanvasMode if necessary
 - call ScribusMainWindow::setAppMode(), which de/activates actions
 */

void ScribusView::requestMode(int appMode)
{
        bool updateNecessary = false;
//      qDebug() << "request mode:" << appMode;
        switch(appMode) // filter submodes
        {
                case submodePaintingDone:   // return to normal mode
                        appMode = modeNormal;
                        m_previousMode = -1;
                        updateNecessary = true;
                        break;
                case submodeEndNodeEdit:     // return from node/shape editing
                        appMode = modeNormal;
                        m_previousMode = -1;
                        updateNecessary = true;
                        break;
                case submodeLoadPic:         // open GetImage dialog
                        m_ScMW->slotGetContent();
                        appMode = Doc->appMode;
                        m_previousMode = appMode;
                        break;
                case submodeStatusPic:       // open ManageImages dialog
                        appMode = Doc->appMode;
                        m_previousMode = appMode;
                        m_ScMW->StatusPic();
                        break;
                case submodeEditExternal:    // open external image editor
                        appMode = Doc->appMode;
                        m_previousMode = appMode;
                        m_ScMW->callImageEditor();
                        break;
                case submodeAnnotProps:
                        appMode = Doc->appMode;
                        m_previousMode = appMode;
                        m_ScMW->ModifyAnnot();
                        break;
                case submodeEditSymbol:
                        appMode = Doc->appMode;
                        m_previousMode = appMode;
                        m_ScMW->editSelectedSymbolStart();
                        break;
                default:
                        if (appMode < 0 || appMode > submodeFirstSubmode)
                                appMode = modeNormal;
                        m_previousMode = appMode;
                        break;
        }

        if (Doc->appMode != appMode)
        {
                m_ScMW->appModeHelper->setApplicationMode(m_ScMW, Doc, appMode);
                CanvasMode* newCanvasMode = modeInstances.value(appMode);
                if (!newCanvasMode)
                {
                        newCanvasMode = CanvasMode::createForAppMode(this, appMode);
                        modeInstances[appMode] = newCanvasMode;
                }
                if (newCanvasMode)
                {
                        m_canvasMode->deactivate(false);
                        m_canvasMode = newCanvasMode;
                        m_canvasMode->activate(false);
                }
                updateNecessary = true;
        }
        else
        {
                m_ScMW->appModeHelper->setApplicationMode(m_ScMW, Doc, appMode);
        }
        if (updateNecessary)
                updateCanvas();
        setCursorBasedOnAppMode(appMode);
}

void ScribusView::setCursorBasedOnAppMode(int appMode)
{
        IconManager* im=IconManager::instance();
        int docSelectionCount = Doc->m_Selection->count();
        switch (appMode)
        {
                case modeDrawShapes:
                case modeDrawArc:
                case modeDrawSpiral:
                        if (docSelectionCount!=0)
                                Deselect(true);
                        setCursor(im->loadCursor("DrawFrame.xpm"));
                        break;
                case modeDrawImage:
                        if (docSelectionCount!=0)
                                Deselect(true);
                        setCursor(im->loadCursor("DrawImageFrame.xpm"));
                        break;
                case modeDrawLatex:
                        if (docSelectionCount!=0)
                                Deselect(true);
                        setCursor(im->loadCursor("DrawLatexFrame.xpm"));
                        break;
                case modeDrawText:
                        if (docSelectionCount!=0)
                                Deselect(true);
                        setCursor(im->loadCursor("DrawTextFrame.xpm"));
                        break;
                case modeDrawTable2:
                        if (docSelectionCount!=0)
                                Deselect(true);
                        setCursor(im->loadCursor("DrawTable.xpm"));
                        break;
                case modeDrawRegularPolygon:
                        if (docSelectionCount!=0)
                                Deselect(true);
                        setCursor(im->loadCursor("DrawPolylineFrame.xpm"));
                        break;
                case modeMagnifier:
                        if (docSelectionCount!=0)
                                Deselect(true);
                        Magnify = true;
                        setCursor(im->loadCursor("LupeZ.xpm"));
                        break;
                case modePanning:
                        setCursor(im->loadCursor("HandC.xpm"));
                        break;
                case modeDrawLine:
                case modeDrawBezierLine:
                        setCursor(QCursor(Qt::CrossCursor));
                        break;
                case modeDrawCalligraphicLine:
                case modeDrawFreehandLine:
                        setCursor(im->loadCursor("DrawFreeLine.png", 0, 32));
                        break;
                case modeEyeDropper:
                        setCursor(im->loadCursor("colorpickercursor.png", 0, 32));
                        break;
                case modeInsertPDFButton:
                case modeInsertPDFRadioButton:
                case modeInsertPDFTextfield:
                case modeInsertPDFCheckbox:
                case modeInsertPDFCombobox:
                case modeInsertPDFListbox:
                case modeInsertPDFTextAnnotation:
                case modeInsertPDFLinkAnnotation:
                case modeInsertPDF3DAnnotation:
                        if (docSelectionCount!=0)
                                Deselect(true);
                        setCursor(QCursor(Qt::CrossCursor));
                        break;
                case modeLinkFrames:
                        setCursor(im->loadCursor("LinkTextFrame.png", 0, 31));
                        break;
                case modeMeasurementTool:
                case modeEditGradientVectors:
                case modeEditMeshGradient:
                case modeEditArc:
                case modeEditPolygon:
                case modeEditSpiral:
                        setCursor(QCursor(Qt::CrossCursor));
                        break;
                default:
                        setCursor(QCursor(Qt::ArrowCursor));
                break;
        }
}



/*
void ScribusView::paintEvent ( QPaintEvent * p )
{
        #ifndef _WIN32
        if (p->spontaneous())
                evSpon = true;
        #endif
        QScrollArea::paintEvent(p);
//      QPainter qp(viewport());
//      drawContents(&qp, p->rect().x(), p->rect().y(), p->rect().width(), p->rect().height());
}
*/


void ScribusView::enterEvent(QEvent * e)
{
        m_canvasMode->enterEvent(e);
        return;
}

void ScribusView::leaveEvent(QEvent *e)
{
        m_canvasMode->leaveEvent(e);
        return;
}

void ScribusView::contentsDragEnterEvent(QDragEnterEvent *e)
{
        QString text;
        bool /* dataFound = false, */ fromFile = false;
        const ScElemMimeData* elemData = dynamic_cast<const ScElemMimeData*>(e->mimeData());
        if (elemData)
                text = elemData->scribusElem();
        else if (e->mimeData()->hasUrls())
        {
                QUrl url = e->mimeData()->urls().at(0);
                QFileInfo fi(url.toLocalFile());
                if (fi.exists())
                {
                        fromFile = true;
                        text = url.toLocalFile();
                }
        }

        bool hasSupportedFormat = !text.isEmpty();
        hasSupportedFormat |= e->mimeData()->hasFormat("text/inline");
        hasSupportedFormat |= e->mimeData()->hasFormat("text/symbol");
        hasSupportedFormat |= e->mimeData()->hasUrls();
        if (!hasSupportedFormat)
        {
                e->ignore();
                return;
        }

        e->accept();
        e->acceptProposedAction();

        if (text.isEmpty())
                return;

        double gx, gy, gw, gh;
        ScriXmlDoc ss;
        if (ss.ReadElemHeader(text, fromFile, &gx, &gy, &gw, &gh))
        {
                FPoint dragPosDoc = m_canvas->globalToCanvas(widget()->mapToGlobal(e->pos()));
                dragX = dragPosDoc.x(); //e->pos().x() / m_canvas->scale();
                dragY = dragPosDoc.y(); //e->pos().y() / m_canvas->scale();
                dragW = gw;
                dragH = gh;
                DraggedGroup = true;
                getDragRectScreen(&gx, &gy, &gw, &gh);
//              QPoint evP = viewport()->mapToGlobal(e->pos());
//              evP -= QPoint(contentsX(), contentsY());
//              redrawMarker->setGeometry(QRect(evP.x() + 1, evP.y() + 1, qRound(gw), qRound(gh)).normalized());
//              if (!redrawMarker->isVisible())
//                      redrawMarker->show();
                emit ItemGeom();
        }
}

void ScribusView::contentsDragMoveEvent(QDragMoveEvent *e)
{
        QString text;
        e->accept();
        if (e->mimeData()->hasText())
        {
                e->acceptProposedAction();
                text = e->mimeData()->text();
                if (DraggedGroup)
                {
//                      double gx, gy, gw, gh;
                        FPoint dragPosDoc = m_canvas->globalToCanvas(widget()->mapToGlobal(e->pos()));
                        dragX = dragPosDoc.x(); //e->pos().x() / m_canvas->scale();
                        dragY = dragPosDoc.y(); //e->pos().y() / m_canvas->scale();
//                      getDragRectScreen(&gx, &gy, &gw, &gh);
//                      QPoint evP = viewport()->mapToGlobal(e->pos());
//                      evP -= QPoint(contentsX(), contentsY());
//                      redrawMarker->setGeometry(QRect(evP.x() + 2, evP.y() + 2, qRound(gw - 2), qRound(gh - 2)).normalized());
//                      if (!redrawMarker->isVisible())
//                              redrawMarker->show();
                        emit MousePos(dragX, dragY); //+Doc->minCanvasCoordinate.x(), dragY+Doc->minCanvasCoordinate.y());
                        QPoint pos = m_canvas->canvasToLocal(dragPosDoc);
                        horizRuler->Draw(pos.x());
                        vertRuler->Draw(pos.y());
//                      return;
                }
/*              QUrl ur(text);
                QFileInfo fi = QFileInfo(ur.toLocalFile());
                QString ext = fi.extension(false).toUpper();
                QStrList imfo = QImageIO::inputFormats();
                if (ext == "JPG")
                        ext = "JPEG";
                img = ((imfo.contains(ext))||(ext=="PS")||(ext=="EPS")||(ext=="TIF"));
                if (!SeleItemPos(e->pos()))
                {
                        if (SelItem.count() != 0)
                                Deselect(true);
                }
                else
                {
                        b = SelItem.at(0);
                        if (img)
                        {
                                if (b->PType != 2)
                                        Deselect(true);
                        }
                        else
                        {
                                if (b->PType != 4)
                                        Deselect(true);
                        }
                } */

        }
}

void ScribusView::contentsDragLeaveEvent(QDragLeaveEvent *)
{
        if (DraggedGroup)
        {
                DraggedGroup = false;
                m_canvas->resetRenderMode();
//              redrawMarker->hide();
                updateContents();
        }
}

void ScribusView::contentsDropEvent(QDropEvent *e)
{
        QString text;
        QUrl url;
        PageItem *currItem;
        UndoTransaction activeTransaction;
        bool img = false;
        m_canvas->resetRenderMode();
//      redrawMarker->hide();
//      struct ScText *hg;
//      uint a;
        int re = 0;
//      e->accept(Q3TextDrag::canDecode(e));
        e->accept();
        bool selectedItemByDrag=false;
        FPoint dropPosDoc = m_canvas->globalToCanvas(widget()->mapToGlobal(e->pos()));
        QPointF dropPosDocQ(dropPosDoc.x(), dropPosDoc.y());
//      int ex = qRound(e->pos().x()/m_canvas->scale());// + Doc->minCanvasCoordinate.x());
//              int ey = qRound(e->pos().y()/m_canvas->scale());// + Doc->minCanvasCoordinate.y());

//  Commented out to fix Bug #11254 (fs)
/*      if (ScMimeData::clipboardHasScribusElem() && (Doc->DraggedElem == 0))
        {
                text = ScMimeData::clipboardScribusElem();
                url  = QUrl(text);
        }
        else*/

        if (e->mimeData()->hasText() && (!e->mimeData()->text().isEmpty()))
        {
                text = e->mimeData()->text();
                url = QUrl(text);
        }
        else if (e->mimeData()->hasUrls())
        {
                url = e->mimeData()->urls().at(0);
                text = "";
        }
        else if (e->mimeData()->hasFormat("text/symbol"))
        {
                e->acceptProposedAction();
                activateWindow();
                if (!m_ScMW->scriptIsRunning())
                        raise();
                m_ScMW->newActWin(((ScribusWin*)(Doc->WinHan))->getSubWin());
                updateContents();
                QString patternVal = e->mimeData()->data("text/symbol");
                Doc->m_Selection->delaySignalsOn();
                for (int i = Doc->Items->count() - 1; i >= 0 ; --i)
                {
                        if (Doc->Items->at(i)->LayerID==Doc->activeLayer())
                        {
                                if ((m_canvas->frameHitTest(dropPosDocQ, Doc->Items->at(i)) >= Canvas::INSIDE) && (Doc->Items->at(i)->itemType() == PageItem::Symbol))
                                {
                                        Deselect(false);
                                        Doc->m_Selection->addItem(Doc->Items->at(i));
                                        Doc->Items->at(i)->setPattern(patternVal);
                                        selectedItemByDrag=true;
                                        break;
                                }
                        }
                }
                Doc->m_Selection->delaySignalsOff();
                if (!selectedItemByDrag)
                {
                        int z = Doc->itemAdd(PageItem::Symbol, PageItem::Unspecified, dropPosDoc.x(), dropPosDoc.y(), 1, 1, 0, CommonStrings::None, CommonStrings::None);
                        PageItem *b = Doc->Items->at(z);
                        b->LayerID = Doc->activeLayer();
                        ScPattern pat = Doc->docPatterns[patternVal];
                        b->setWidth(pat.width);
                        b->setHeight(pat.height);
                        b->OldB2 = b->width();
                        b->OldH2 = b->height();
                        b->setPattern(patternVal);
                        b->updateClip();
                        Deselect(false);
                        Doc->m_Selection->addItem(b);
                }
                emit DocChanged();
                update();
                return;
        }
        else if (e->mimeData()->hasFormat("text/inline"))
        {
                if (((Doc->appMode == modeEditTable) || (Doc->appMode == modeEdit)) && (!Doc->m_Selection->isEmpty()))
                {
                        PageItem *b = Doc->m_Selection->itemAt(0);
                        if (b->isTextFrame() || b->isTable())
                        {
                                e->acceptProposedAction();
                                activateWindow();
                                if (!m_ScMW->scriptIsRunning())
                                        raise();
                                m_ScMW->newActWin(((ScribusWin*)(Doc->WinHan))->getSubWin());
                                updateContents();
                                QString patternVal = e->mimeData()->data("text/inline");
                                int id = patternVal.toInt();
                                PageItem_TextFrame *cItem;
                                if (Doc->appMode == modeEditTable)
                                        cItem = b->asTable()->activeCell().textFrame();
                                else
                                        cItem = b->asTextFrame();
                                if (cItem->HasSel)
                                        cItem->deleteSelectedTextFromFrame();
                                cItem->invalidateLayout(false);
                                cItem->itemText.insertObject(id);
                                if (b->isTable())
                                        b->asTable()->update();
                                else
                                        b->update();
                                emit DocChanged();
                                update();
                                return;
                        }
                }
        }

//      qDebug() << "ScribusView::contentsDropEvent" << e->mimeData()->formats() << url;
        if (url.isEmpty())
        {
                e->ignore();
                return;
        }

        e->acceptProposedAction();
        //<<#3524
        activateWindow();
        if (!m_ScMW->scriptIsRunning())
                raise();
        m_ScMW->newActWin(((ScribusWin*)(Doc->WinHan))->getSubWin());
        updateContents();
        //>>
        QFileInfo fi;
        QString ext = "";
        if (!e->mimeData()->formats().contains("application/x-scribus-elem"))
        {
                fi.setFile(url.toLocalFile());
                ext = fi.suffix().toUpper();
        }
//              QFileInfo fi(url.toLocalFile());
//              QString ext = fi.suffix().toUpper();
        QStringList imfo;
        QList<QByteArray> imgs = QImageReader::supportedImageFormats();
        for (int i = 0; i < imgs.count(); ++i )
        {
                imfo.append(QString(imgs.at(i)).toUpper());
        }
        if (ext == "JPG")
                ext = "JPEG";
        QString formatD(FormatsManager::instance()->extensionListForFormat(FormatsManager::IMAGESIMGFRAME, 1).toUpper());
        imfo += formatD.split("|");
        img = imfo.contains(ext);
        //CB Need to handle this ugly file extension list elsewhere... some capabilities class perhaps
//      img = ((imfo.contains(ext)) || extensionIndicatesPDF(ext) || extensionIndicatesEPSorPS(ext) || extensionIndicatesTIFF(ext) || extensionIndicatesJPEG(ext) || extensionIndicatesPSD(ext));
//              int pscx=qRound(e->pos().x()/m_canvas->scale()), pscy=qRound(e->pos().y()/m_canvas->scale());
        //Loop through all items and see which one(s) were under the drop point on the current layer
        //Should make a nice function for this.
        //#9051 :  loop in reverse order so that items in front of others are prioritized
        Doc->m_Selection->delaySignalsOn();
        for (int i = Doc->Items->count() - 1; i >= 0 ; --i)
        {
                if (Doc->Items->at(i)->LayerID==Doc->activeLayer())
                {
                        if (m_canvas->frameHitTest(dropPosDocQ, Doc->Items->at(i)) >= Canvas::INSIDE)
                        {
                                Deselect(false);
                                Doc->m_Selection->addItem(Doc->Items->at(i));
//                                      SelectItem(Doc->Items->at(i));
                                selectedItemByDrag=true;
                                break;
                        }
                }
        }
        Doc->m_Selection->delaySignalsOff();
        bool vectorFile = false;
        if (fi.exists())
        {
                if (fi.suffix().toLower() == "sce")
                        vectorFile = true;
                else
                {
                        FileLoader *fileLoader = new FileLoader(url.toLocalFile());
                        int testResult = fileLoader->testFile();
                        delete fileLoader;
                        if ((testResult != -1) && (testResult >= FORMATID_FIRSTUSER))
                                vectorFile = true;
                }
        }
        else
        {
                if ((text.startsWith("<SCRIBUSELEM")) || (text.startsWith("SCRIBUSFRAGMENT")))
                        vectorFile = true;
        }
//              qDebug() << "drop - img:" << img << "file:" << fi.exists() << "suffix:" << fi.suffix() << "select by drag:" << selectedItemByDrag;
        //CB When we drag an image to a page from outside
        //SeleItemPos is from 1.2.x. Needs reenabling for dragging *TO* a frame
        if ((fi.exists()) && (img) && !selectedItemByDrag && !vectorFile)// && (!SeleItemPos(e->pos())))
        {
                int z = Doc->itemAdd(PageItem::ImageFrame, PageItem::Unspecified, dropPosDoc.x(), dropPosDoc.y(), 1, 1, Doc->itemToolPrefs().shapeLineWidth, Doc->itemToolPrefs().imageFillColor, Doc->itemToolPrefs().imageStrokeColor);
                PageItem *b = Doc->Items->at(z);
                b->LayerID = Doc->activeLayer();
                Doc->loadPict(url.toLocalFile(), b);

                double iw = static_cast<double>(b->OrigW * 72.0 / b->pixm.imgInfo.xres);
                double ih = static_cast<double>(b->OrigH * 72.0 / b->pixm.imgInfo.yres);
                if (iw > ih)
                {
                        double pw = Doc->currentPage()->width();
                        if (iw > pw)
                        {
                                ih = pw * (ih / iw);
                                iw = pw;
                        }
                }
                else
                {
                        double ph = Doc->currentPage()->height();
                        if (ih > ph)
                        {
                                iw = ph * (iw / ih);
                                ih = ph;
                        }
                }

                b->setWidth(iw);
                b->setHeight(ih);
                b->OldB2 = b->width();
                b->OldH2 = b->height();
                b->updateClip();
                b->AdjustPictScale();
                b->update();
                emit DocChanged();
                update();
                return;
        }
        //if ((SeleItemPos(e->pos())) && (!text.startsWith("<SCRIBUSELEM")))
//              if (Doc->m_Selection->count()>0 && (m_canvas->frameHitTest(dropPosDocQ, Doc->m_Selection->itemAt(0)) >= Canvas::INSIDE) && !vectorFile) // && (img))
        if (selectedItemByDrag && (m_canvas->frameHitTest(dropPosDocQ, Doc->m_Selection->itemAt(0)) >= Canvas::INSIDE) && ((!vectorFile) || (img)))
        {
                PageItem *b = Doc->m_Selection->itemAt(0);
                if (b->itemType() == PageItem::ImageFrame)
                {
                        if ((fi.exists()) && (img))
                                Doc->loadPict(url.toLocalFile(), b);
                }
                else if (b->itemType() == PageItem::TextFrame)
                {
                        if ((fi.exists()) && (!img))
                        {
                                QByteArray file;
                                QTextCodec *codec = QTextCodec::codecForLocale();
                                // TODO create a Dialog for selecting the codec
                                if (loadRawText(url.toLocalFile(), file))
                                {
                                        QString txt = codec->toUnicode( file.data() );
                                        txt.replace(QRegExp("\r"), QChar(13));
                                        txt.replace(QRegExp("\n"), QChar(13));
                                        txt.replace(QRegExp("\t"), QChar(9));
                                        b->itemText.insertChars(txt, true);
                                        if (Doc->docHyphenator->AutoCheck)
                                                Doc->docHyphenator->slotHyphenate(b);
                                        b->invalidateLayout();
                                        b->update();
                                }
                        }
                }
                emit DocChanged();
                update();
        }
        else
        {
                Deselect(true);
                uint oldDocItemCount = Doc->Items->count();
                if (((!img) || (vectorFile)) && (Doc->DraggedElem == 0))
                {
                        activeTransaction = undoManager->beginTransaction(Um::SelectionGroup, Um::IGroup, Um::Create, "", Um::ICreate);
                        if (fi.exists())
                        {
                                if (fi.suffix().toLower() == "sce")
                                {
                                        emit LoadElem(url.toLocalFile(), dropPosDoc.x(), dropPosDoc.y(), true, false, Doc, this);
                                }
                                else
                                {
                                        FileLoader *fileLoader = new FileLoader(url.toLocalFile());
                                        int testResult = fileLoader->testFile();
                                        delete fileLoader;
                                        if ((testResult != -1) && (testResult >= FORMATID_FIRSTUSER))
                                        {
                                                const FileFormat * fmt = LoadSavePlugin::getFormatById(testResult);
                                                if( fmt )
                                                {
                                                        // We disable undo here as we are only interested by the item creation undo actions
                                                        // We create them manually after import
                                                        undoManager->setUndoEnabled(false);
                                                        Doc->dontResize = true;
                                                        fmt->loadFile(url.toLocalFile(), LoadSavePlugin::lfUseCurrentPage|LoadSavePlugin::lfInteractive|LoadSavePlugin::lfScripted);
                                                        undoManager->setUndoEnabled(true);
                                                        if (Doc->m_Selection->count() > 0)
                                                        {
                                                                if (UndoManager::undoEnabled())
                                                                {
                                                                        // Create undo actions for created items
                                                                        for (int i = 0; i < Doc->m_Selection->count(); ++i)
                                                                        {
                                                                                PageItem* newItem = Doc->m_Selection->itemAt(i);
                                                                                ScItemState<PageItem*> *is = new ScItemState<PageItem*>("Create PageItem");
                                                                                is->set("CREATE_ITEM");
                                                                                is->setItem(newItem);
                                                                                //Undo target rests with the Page for object specific undo
                                                                                int pindex = (newItem->OwnPage > -1) ? newItem->OwnPage : 0;
                                                                                UndoObject *target = Doc->Pages->at(pindex);
                                                                                undoManager->action(target, is);
                                                                        }
                                                                }
                                                                double x2, y2, w, h;
                                                                // We disable undo temporarily as move actions are not necessary
                                                                // to perform undo correctly here
                                                                undoManager->setUndoEnabled(false);
                                                                Doc->m_Selection->getGroupRect(&x2, &y2, &w, &h);
                                                                Doc->moveGroup(dropPosDoc.x() - x2, dropPosDoc.y() - y2);
                                                                m_ScMW->requestUpdate(reqColorsUpdate | reqSymbolsUpdate | reqTextStylesUpdate | reqLineStylesUpdate);
                                                                undoManager->setUndoEnabled(true);
                                                        }
                                                        Doc->dontResize = false;
                                                }
                                        }
                                }
                        }
                        else
                        {
                                emit LoadElem(QString(text), dropPosDoc.x(), dropPosDoc.y(), false, false, Doc, this);
                        }
                        Selection tmpSelection(this, false);
                        tmpSelection.copy(*Doc->m_Selection, true);
                        for (int as = oldDocItemCount; as < Doc->Items->count(); ++as)
                        {
                                currItem = Doc->Items->at(as);
                                Doc->setRedrawBounding(currItem);
                                tmpSelection.addItem(currItem, true);
                                if (currItem->isBookmark)
                                        emit AddBM(currItem);
                        }
                        Doc->m_Selection->copy(tmpSelection, false);
                        if (Doc->m_Selection->count() == 1)
                        {
                                PageItem *newItem = Doc->m_Selection->itemAt(0);
                                if ((newItem->width() > Doc->currentPage()->width()) || (newItem->height() > Doc->currentPage()->height()))
                                {
                                //      QMenu *pmen = new QMenu();
                                //      pmen->addAction( tr("Keep original Size"));
                                //      pmen->addAction( tr("Scale to Page Size"));
                                //      re = pmen->actions().indexOf(pmen->exec(QCursor::pos()));
                                //      delete pmen;
                                //      if (re == 1)
                                //      {
                                                Doc->rescaleGroup(newItem, qMin(qMin(Doc->currentPage()->width() / newItem->width(), Doc->currentPage()->height() / newItem->height()), 1.0));
                                                newItem->update();
                                //      }
                                }
                        }
                        activeTransaction.commit();
                        activeTransaction.reset();
                }
                else
                {
                        if (Doc->DraggedElem != 0)
                        {
                                if (!Doc->leaveDrag)
                                {
                                        QMenu *pmen = new QMenu();
                                        pmen->addAction( tr("Copy Here"));
                                        QAction* mov = pmen->addAction( tr("Move Here"));
                                        pmen->addAction( tr("Cancel"));
                                        for (int dre=0; dre<Doc->DragElements.count(); ++dre)
                                        {
                                                if (Doc->DragElements[dre]->locked())
                                                {
                                                        mov->setEnabled(false);
                                                        break;
                                                }
                                        }
                                        re = pmen->actions().indexOf(pmen->exec(QCursor::pos()));
                                        delete pmen;
                                        pmen=NULL;
                                }
                                else
                                        re = 1;
                                if ((re == 2) || (re == -1))
                                {
                                        updateContents();
                                        return;
                                }
                                if ((re == 1) || (Doc->leaveDrag))
                                {
                                        QList<PageItem*> pasted;
                                        emit LoadElem(QString(text), dropPosDoc.x(), dropPosDoc.y(), false, false, Doc, this);
                                        for (int as = oldDocItemCount; as < Doc->Items->count(); ++as)
                                        {
                                                pasted.append(Doc->Items->at(as));
                                        }
                                        Selection tmpSelection(this, false);
                                        tmpSelection.copy(*Doc->m_Selection, true);
                                        for (int dre=0; dre<Doc->DragElements.count(); ++dre)
                                        {
                                                tmpSelection.addItem(Doc->DragElements[dre], true);
                                        }
                                        Doc->m_Selection->copy(tmpSelection, false);
                                        PageItem* bb;
                                        int fin;
                                        for (int dre=0; dre<Doc->DragElements.count(); ++dre)
                                        {
                                                bb = pasted.at(dre);
                                                currItem = Doc->m_Selection->itemAt(dre);
                                                if ((currItem->asTextFrame()) && ((currItem->nextInChain() != 0) || (currItem->prevInChain() != 0)))
                                                {
                                                        PageItem* before = currItem->prevInChain();
                                                        PageItem* after = currItem->nextInChain();
                                                        currItem->unlink();
                                                        if (before != 0)
                                                        {
                                                                fin = Doc->m_Selection->findItem(before);
                                                                if (fin != -1)
                                                                        before = pasted.at(fin);
                                                                before->unlink();
                                                                before->link(bb);
                                                        }
                                                        if (after != 0)
                                                        {
                                                                fin = Doc->m_Selection->findItem(after);
                                                                if (fin != -1)
                                                                        after = pasted.at(fin);
                                                                bb->link(after);
                                                        }
                                                }
                                        }
                                        pasted.clear();
                                        Doc->itemSelection_DeleteItem();
                                }
                        }
                        if ((!img) && ((re == 0)))
                                emit LoadElem(QString(text), dropPosDoc.x(), dropPosDoc.y(), false, false, Doc, this);
                        Doc->DraggedElem = 0;
                        Doc->DragElements.clear();
                        Selection tmpSelection(this, false);
                        tmpSelection.copy(*Doc->m_Selection, true);
                        for (int as = oldDocItemCount; as < Doc->Items->count(); ++as)
                        {
                                currItem = Doc->Items->at(as);
                                Doc->setRedrawBounding(currItem);
                                tmpSelection.addItem(currItem, true);
                                if (currItem->isBookmark)
                                        emit AddBM(currItem);
                        }
                        Doc->m_Selection->copy(tmpSelection, false);
                }
                if (Doc->m_Selection->count() > 1)
                {
                        Doc->m_Selection->connectItemToGUI();
                        Doc->m_Selection->setGroupRect();
                        double gx, gy, gh, gw;
                        Doc->m_Selection->getGroupRect(&gx, &gy, &gw, &gh);
                        double nx = gx;
                        double ny = gy;
                        if (!Doc->ApplyGuides(&nx, &ny) && !Doc->ApplyGuides(&nx, &ny,true))
                        {
                                FPoint npx;
                                npx = Doc->ApplyGridF(FPoint(nx, ny));
                                nx = npx.x();
                                ny = npx.y();
                        }
                        activeTransaction = undoManager->beginTransaction(Um::SelectionGroup, Um::IGroup, Um::Move, "", Um::IMove);
                        Doc->moveGroup(nx-gx, ny-gy);
                        Doc->m_Selection->setGroupRect();
                        Doc->m_Selection->getGroupRect(&gx, &gy, &gw, &gh);
                        nx = gx+gw;
                        ny = gy+gh;
                        Doc->ApplyGuides(&nx, &ny);
                        Doc->ApplyGuides(&nx, &ny,true);
                        Doc->moveGroup(nx-(gx+gw), ny-(gy+gh));
                        Doc->m_Selection->setGroupRect();
                        Doc->m_Selection->getGroupRect(&gx, &gy, &gw, &gh);
                        for (int a = 0; a < Doc->m_Selection->count(); ++a)
                        {
                                PageItem *currItem = Doc->m_Selection->itemAt(a);
                                currItem->LayerID = Doc->activeLayer();
                                currItem->gXpos = currItem->xPos() - gx;
                                currItem->gYpos = currItem->yPos() - gy;
                                currItem->gWidth = gw;
                                currItem->gHeight = gh;
                        }
                        activeTransaction.commit();
                        activeTransaction.reset();
                        emit ItemGeom();
                }
                else if (Doc->m_Selection->count() == 1)
                {
                        Doc->m_Selection->connectItemToGUI();
                        currItem = Doc->m_Selection->itemAt(0);
                        currItem->LayerID = Doc->activeLayer();
                        if (Doc->SnapGrid)
                        {
                                double nx = currItem->xPos();
                                double ny = currItem->yPos();
                                if (!Doc->ApplyGuides(&nx, &ny) && !Doc->ApplyGuides(&nx, &ny,true))
                                {
                                        FPoint npx;
                                        npx = Doc->ApplyGridF(FPoint(nx, ny));
                                        nx = npx.x();
                                        ny = npx.y();
                                }
                                Doc->moveItem(nx-currItem->xPos(), ny-currItem->yPos(), currItem);
                        }
                }
                if ((Doc->m_Selection->count() > 0) && (Doc->appMode != modeNormal))
                        this->requestMode(modeNormal);
                updateContents();
        }
        if (!Doc->masterPageMode())
        {
                uint docPagesCount=Doc->Pages->count();
                uint docCurrPageNo=Doc->currentPageNumber();
                for (uint i = 0; i < docPagesCount; ++i)
                {
                        double x = Doc->Pages->at(i)->xOffset();
                        double y = Doc->Pages->at(i)->yOffset();
                        double w = Doc->Pages->at(i)->width();
                        double h = Doc->Pages->at(i)->height();
                        if (QRectF(x, y, w, h).contains(dropPosDocQ))
                        {
                                if (docCurrPageNo != i)
                                {
                                        Doc->setCurrentPage(Doc->Pages->at(i));
                                        m_ScMW->slotSetCurrentPage(i);
                                        DrawNew();
                                }
                                break;
                        }
                }
                setRulerPos(contentsX(), contentsY());
        }
}


/*
void ScribusView::normalizeSelectionRect() // unsused
{
        if(Mxp > SeRx)
        {
                int tmp = SeRx;
                SeRx = Mxp;
                Mxp = tmp;
        }
        if(Myp > SeRy)
        {
                int tmp = SeRy;
                SeRy = Myp;
                Myp = tmp;
        }
}
*/



void ScribusView::getDragRectScreen(double *x, double *y, double *w, double *h)
{
        QPoint in(qRound(dragX*m_canvas->scale()), qRound(dragY*m_canvas->scale()));
//      in -= QPoint(qRound(Doc->minCanvasCoordinate.x() * m_canvas->scale()), qRound(Doc->minCanvasCoordinate.y() * m_canvas->scale()));
        QPoint out = contentsToViewport(in);
        *x = static_cast<double>(out.x());
        *y = static_cast<double>(out.y());
        *w = dragW*m_canvas->scale();
        *h = dragH*m_canvas->scale();
}

void ScribusView::getGroupRectScreen(double *x, double *y, double *w, double *h)
{
        double gx, gy, gh, gw;
        Doc->m_Selection->getGroupRect(&gx, &gy, &gw, &gh);
        QPoint in(qRound(gx*m_canvas->scale()), qRound(gy*m_canvas->scale()));
//      in -= QPoint(qRound(Doc->minCanvasCoordinate.x() * m_canvas->scale()), qRound(Doc->minCanvasCoordinate.y() * m_canvas->scale()));
        QPoint out = contentsToViewport(in);
        *x = static_cast<double>(out.x());
        *y = static_cast<double>(out.y());
        *w = gw*m_canvas->scale();
        *h = gh*m_canvas->scale();
}



void ScribusView::RefreshGradient(PageItem *currItem, double dx, double dy)
{
        QTransform matrix;
        QRect rect = currItem->getRedrawBounding(m_canvas->scale());
        m_canvas->Transform(currItem, matrix);
        FPointArray fpNew;
        if (editStrokeGradient)
                fpNew.setPoints(2, currItem->GrStrokeStartX, currItem->GrStrokeStartY, currItem->GrStrokeEndX, currItem->GrStrokeEndY);
        else
                fpNew.setPoints(2, currItem->GrStartX, currItem->GrStartY, currItem->GrEndX, currItem->GrEndY);
        fpNew.map(matrix);
        if (dx < 8.0) dx = 8.0;
        if (dy < 8.0) dy = 8.0;
        int grl = (int) floor( qMin(fpNew.point(0).x(), fpNew.point(1).x()) - dx );
        int grr = (int) ceil ( qMax(fpNew.point(0).x(), fpNew.point(1).x()) + dx );
        int grb = (int) ceil ( qMax(fpNew.point(0).y(), fpNew.point(1).y()) + dy );
        int grt = (int) floor( qMin(fpNew.point(0).y(), fpNew.point(1).y()) - dy );
        rect |= QRect(grl, grt, grr-grl, grb-grt);
        updateContents(rect);
}


//CB-->elsewhere, util, however, only used in the view for now
bool ScribusView::PointOnLine(QPoint Start, QPoint End, QRect MArea)
{
        QPoint an, en;
        if (Start.x() == End.x())
        {
                an = Start.y() > End.y() ? End : Start;
                en = an == End ? Start : End;
                for (int a=an.y(); a<en.y(); ++a)
                {
                        if (MArea.contains(an.x(), a))
                                return true;
                }
        }
        if (Start.y() == End.y())
        {
                an = Start.x() > End.x() ? End : Start;
                en = an == End ? Start : End;
                for (int a=an.x(); a<en.x(); ++a)
                {
                        if (MArea.contains(a, an.y()))
                                return true;
                }
        }
        if (abs(Start.x() - End.x()) > abs(Start.y() - End.y()))
        {
                an = Start.x() > End.x() ? End : Start;
                en = an == End ? Start : End;
                double stg = (en.y() - an.y()) / static_cast<double>((en.x() - an.x()));
                for (int a = an.x(); a < en.x(); ++a)
                {
                        if (MArea.contains(a, an.y()+qRound((a-an.x())*stg)))
                                return true;
                }
        }
        else
        {
                an = Start.y() > End.y() ? End : Start;
                en = an == End ? Start : End;
                double stg = (en.x() - an.x()) / static_cast<double>((en.y() - an.y()));
                for (int a = an.y(); a < en.y(); ++a)
                {
                        if (MArea.contains(an.x()+qRound((a-an.y())*stg), a))
                                return true;
                }
        }
        return false;
}

//CB-->Doc??
void ScribusView::TransformPoly(int mode, int rot, double scaling)
{
        PageItem *currItem = Doc->m_Selection->itemAt(0);
        QRectF oldR = currItem->getBoundingRect().adjusted(-5, -5, 10, 10);
        currItem->ClipEdited = true;
        QTransform ma;
        undoManager->setUndoEnabled(false);
        if (Doc->nodeEdit.isContourLine())
        {
                FPoint tp2(getMinClipF(&currItem->ContourLine));
                FPoint tp(getMaxClipF(&currItem->ContourLine));
                FPoint tpS = currItem->ContourLine.WidthHeight();
                currItem->ContourLine.translate(-qRound((tp.x() + tp2.x()) / 2.0), -qRound((tp.y() + tp2.y()) / 2.0));
                switch (mode)
                {
                case 0:
                        ma.rotate(-rot);
                        break;
                case 1:
                        ma.rotate(rot);
                        break;
                case 2:
                        ma.scale(1.0 - (scaling / 100.0), 1.0 - (scaling / 100.0));
                        break;
                case 3:
                        ma.scale(1.0 + (scaling / 100.0), 1.0 + (scaling / 100.0));
                        break;
                case 4:
                        ma.shear(0.017455, 0);
                        break;
                case 5:
                        ma.shear(-0.017455, 0);
                        break;
                case 6:
                        ma.shear(0, -0.017455);
                        break;
                case 7:
                        ma.shear(0, 0.017455);
                        break;
                case 8:
                        ma.scale(1.0 - (scaling / tpS.x()),1.0 - (scaling / tpS.y()));
                        break;
                case 9:
                        ma.scale(1.0 + (scaling / tpS.x()),1.0 + (scaling / tpS.y()));
                        break;
                //10-13 are for scaling the contour line in shape edit mode
                case 10:
                        {
                                double s=1.0 - (scaling/(tp2.x() - tp.x()));
                                ma.scale(s, 1);
                                ma.translate(-scaling/s/2,0);
                        }
                        break;
                case 11:
                        {
                                double s=1.0 - (scaling/(tp2.x() - tp.x()));
                                ma.scale(s, 1);
                                ma.translate(scaling/s/2,0);
                        }
                        break;
                case 12:
                        {
                                double s=1.0 - (scaling/(tp2.y() - tp.y()));
                                ma.scale(1, s);
                                ma.translate(0,-scaling/s/2);
                        }
                        break;
                case 13:
                        {
                                double s=1.0 - (scaling/(tp2.y() - tp.y()));
                                ma.scale(1, s);
                                ma.translate(0,scaling/s/2);
                        }
                        break;
                }
                currItem->ContourLine.map(ma);
                currItem->ContourLine.translate(qRound((tp.x() + tp2.x()) / 2.0), qRound((tp.y() + tp2.y()) / 2.0));
                updateContents();
                currItem->FrameOnly = true;
                updateContents(currItem->getRedrawBounding(m_canvas->scale()));
                undoManager->setUndoEnabled(true);
                if (UndoManager::undoEnabled())
                {
                        undoManager->setUndoEnabled(false);
                        currItem->checkChanges(true);
                        undoManager->setUndoEnabled(true);
                        SimpleState *ss = new SimpleState(Um::EditContourLine, "", Um::IBorder);
                        ss->set("EDIT_CONTOUR");
                        ss->set("MODE", mode);
                        ss->set("ROT", rot);
                        ss->set("SCALING", scaling);
                        undoManager->action(currItem, ss);
                }
                emit DocChanged();
                return;
        }
        FPoint oldPos(currItem->xyPos());
        double offsX = currItem->width() / 2.0;
        double offsY = currItem->height() / 2.0;
        double oldWidth = currItem->width();
        double oldHeight = currItem->height();
        ma.translate(-offsX, -offsY);
        switch (mode)
        {
        case 0:
                ma.rotate(-rot);
                break;
        case 1:
                ma.rotate(rot);
                break;
        case 2:
                ma.scale(1.0 - (scaling / 100.0), 1.0 - (scaling / 100.0));
                break;
        case 3:
                ma.scale(1.0 + (scaling / 100.0), 1.0 + (scaling / 100.0));
                break;
        case 4:
                ma.shear(0.017455, 0);
                break;
        case 5:
                ma.shear(-0.017455, 0);
                break;
        case 6:
                ma.shear(0, -0.017455);
                break;
        case 7:
                ma.shear(0, 0.017455);
                break;
        case 8:
                ma.scale(1.0 - (scaling / oldWidth),1.0 - (scaling / oldHeight));
                break;
        case 9:
                ma.scale(1.0 + (scaling / oldWidth),1.0 + (scaling / oldHeight));
                break;
        }
        currItem->PoLine.map(ma);
        currItem->PoLine.translate(offsX, offsY);
        Doc->adjustItemSize(currItem);
        QTransform ma2;
        ma2.translate(oldPos.x(), oldPos.y());
        ma2.scale(1, 1);
        ma2.translate(offsX, offsY);
        FPoint n(-offsX, -offsY);
        switch (mode)
        {
        case 0:
                ma2.rotate(-rot);
                break;
        case 1:
                ma2.rotate(rot);
                break;
        case 2:
                ma2.scale(1.0 - (scaling / 100.0), 1.0 - (scaling / 100.0));
                break;
        case 3:
                ma2.scale(1.0 + (scaling / 100.0), 1.0 + (scaling / 100.0));
                break;
        case 4:
                ma2.shear(0.017455, 0);
                break;
        case 5:
                ma2.shear(-0.017455, 0);
                break;
        case 6:
                ma2.shear(0, -0.017455);
                break;
        case 7:
                ma2.shear(0, 0.017455);
                break;
        case 8:
                ma2.scale(1.0 - (scaling / oldWidth),1.0 - (scaling / oldHeight));
                break;
        case 9:
                ma2.scale(1.0 + (scaling / oldWidth),1.0 + (scaling / oldHeight));
                break;
        }
        double x = ma2.m11() * n.x() + ma2.m21() * n.y() + ma2.dx();
        double y = ma2.m22() * n.y() + ma2.m12() * n.x() + ma2.dy();
        Doc->moveItem(x-oldPos.x(), y-oldPos.y(), currItem);
        if (currItem->asPathText())
                currItem->updatePolyClip();
        Doc->setRedrawBounding(currItem);
        QRectF newR(currItem->getBoundingRect());
        Doc->regionsChanged()->update(newR.united(oldR));
        currItem->update();
//      MarkClip(currItem, currItem->PoLine, true);
        currItem->FrameType = 3;
        undoManager->setUndoEnabled(true);
        if (UndoManager::undoEnabled())
        {
                undoManager->setUndoEnabled(false);
                currItem->checkChanges(true);
                undoManager->setUndoEnabled(true);
                SimpleState *ss = new SimpleState(Um::EditShape, "", Um::IBorder);
                ss->set("EDIT_SHAPE");
                ss->set("MODE", mode);
                ss->set("ROT", rot);
                ss->set("SCALING", scaling);
                undoManager->action(currItem, ss);
        }
        emit DocChanged();
}

bool ScribusView::slotSetCurs(int x, int y)
{
        PageItem *item;
        if (!Doc->getItem(&item))
                return false;

        PageItem_TextFrame *textFrame;
        QPointF canvasPoint;
        QTransform mm = item->getTransform();
        QPointF textFramePoint = mm.map(QPointF(0, 0));
        if (item->isTextFrame())
        {
                textFrame = item->asTextFrame();
                canvasPoint = m_canvas->globalToCanvas(QPoint(x,y)).toQPointF();
        }
        else if (item->isTable())
        {
                // Move to cell under cursor and position the text cursor.
                PageItem_Table *table = item->asTable();
                QPointF tablePoint = m_canvas->globalToCanvas(QPoint(x, y)).toQPointF();
                table->moveTo(table->cellAt(tablePoint));
                textFrame = table->activeCell().textFrame();
                mm = textFrame->getTransform();
                canvasPoint = table->getTransform().inverted().map(tablePoint) - table->gridOffset();
        }
        else if (item->isImageFrame())
                return true;
        else
                return false;

        if (m_canvas->frameHitTest(canvasPoint, textFrame) == Canvas::INSIDE)
        {
                // #9592 : layout must be valid here, or screenToPosition() may crash
                if (textFrame->invalid)
                        textFrame->layout();

                double px = canvasPoint.x() - textFramePoint.x();
                double py = canvasPoint.y() - textFramePoint.y();
                FPoint point(px, py);
                if (mm.isInvertible() && textFrame->itemText.length() > 0)
                {
                        qreal tx = 0, ty = 0;
                        mm.inverted().map(canvasPoint.x(), canvasPoint.y(), &tx, &ty);
                        point.setXY(tx, ty);
                }
                if (textFrame->imageFlippedH())
                        point.setX(textFrame->width() - point.x());
                if (textFrame->imageFlippedV())
                        point.setY(textFrame->height() - point.y());
                if (textFrame->itemText.length() == 0)
                        textFrame->itemText.setCursorPosition(0);
                else
                {
                        int result = textFrame->textLayout.pointToPosition(point.toQPointF());
                        if (result >= 0)
                                textFrame->itemText.setCursorPosition(result);
                }

                if (textFrame->itemText.length() > 0)
                {
                        int pos = qMax(qMin(textFrame->itemText.cursorPosition() - 1, textFrame->itemText.length()), 0);
                        Doc->currentStyle.charStyle() = textFrame->itemText.charStyle(pos);
                        emit ItemCharStyle(Doc->currentStyle.charStyle());
                        emit ItemTextEffects(Doc->currentStyle.charStyle().effects());
                        emit ItemTextAlign(textFrame->itemText.paragraphStyle(pos).alignment());
                        return true;
                }
                else
                {
                        Doc->currentStyle.charStyle() = textFrame->itemText.defaultStyle().charStyle();
                        emit ItemCharStyle(textFrame->itemText.defaultStyle().charStyle());
                        emit ItemTextEffects(textFrame->itemText.defaultStyle().charStyle().effects());
                        emit ItemTextAlign(0);
                        return true;
                }
        }
        return false;
}


void ScribusView::dragTimerTimeOut()
{
        m_dragTimerFired = true;
        // #0007865
//      qApp->changeOverrideCursor(QCursor(loadIcon("DragPix.xpm")));
}

void ScribusView::HandleCurs(PageItem *currItem, QRect mpo)
{
        QPoint tx, tx2;
        QTransform ma;
//      ma.translate(-Doc->minCanvasCoordinate.x()*m_canvas->scale(), -Doc->minCanvasCoordinate.y()*m_canvas->scale());
        m_canvas->Transform(currItem, ma);
        tx = ma.map(QPoint(static_cast<int>(currItem->width()), 0));
        tx2 = ma.map(QPoint(0, static_cast<int>(currItem->height())));
        if (mpo.contains(tx) || mpo.contains(tx2))
        {
                if (Doc->appMode == modeRotation)
                        setCursor(IconManager::instance()->loadCursor("Rotieren2.png"));
                else
                {
                        double rr = fabs(currItem->rotation());
                        if (((rr >= 0.0) && (rr < 45.0)) || ((rr >= 135.0) && (rr < 225.0)) || ((rr >=315.0) && (rr <= 360.0)))
                                setCursor(QCursor(Qt::SizeBDiagCursor));
                        if (((rr >= 45.0) && (rr < 135.0)) || ((rr >= 225.0) && (rr < 315.0)))
                                setCursor(QCursor(Qt::SizeFDiagCursor));
                }
        }
        tx = ma.map(QPoint(static_cast<int>(currItem->width()), static_cast<int>(currItem->height())/2));
        tx2 = ma.map(QPoint(0, static_cast<int>(currItem->height())/2));
        if (mpo.contains(tx) || mpo.contains(tx2))
        {
                double rr = fabs(currItem->rotation());
                if (((rr >= 0.0) && (rr < 45.0)) || ((rr >= 135.0) && (rr < 225.0)) || ((rr >= 315.0) && (rr <= 360.0)))
                        setCursor(QCursor(Qt::SizeHorCursor));
                if (((rr >= 45.0) && (rr < 135.0)) || ((rr >= 225.0) && (rr < 315.0)))
                        setCursor(QCursor(Qt::SizeVerCursor));
        }
        tx = ma.map(QPoint(static_cast<int>(currItem->width())/2, 0));
        tx2 = ma.map(QPoint(static_cast<int>(currItem->width())/2, static_cast<int>(currItem->height())));
        if (mpo.contains(tx) || mpo.contains(tx2))
        {
                double rr = fabs(currItem->rotation());
                if (((rr >= 0.0) && (rr < 45.0)) || ((rr >= 135.0) && (rr < 225.0)) || ((rr >= 315.0) && (rr <= 360.0)))
                        setCursor(QCursor(Qt::SizeVerCursor));
                if (((rr >= 45.0) && (rr < 135.0)) || ((rr >= 225.0) && (rr < 315.0)))
                        setCursor(QCursor(Qt::SizeHorCursor));
        }
        tx = ma.map(QPoint(static_cast<int>(currItem->width()), static_cast<int>(currItem->height())));
        tx2 = ma.map(QPoint(0, 0));
        if (mpo.contains(tx) || mpo.contains(tx2))
        {
                if (Doc->appMode == modeRotation)
                        setCursor(IconManager::instance()->loadCursor("Rotieren2.png"));
                else if (!currItem->sizeHLocked() && ! currItem->sizeVLocked())
                {
                        double rr = fabs(currItem->rotation());
                        if (((rr >= 0.0) && (rr < 45.0)) || ((rr >= 135.0) && (rr < 225.0)) ||
                                ((rr >= 315.0) && (rr <= 360.0)))
                                setCursor(QCursor(Qt::SizeFDiagCursor));
                        if (((rr >= 45.0) && (rr < 135.0)) || ((rr >= 225.0) && (rr < 315.0)))
                                setCursor(QCursor(Qt::SizeBDiagCursor));
                }
        }
        if (Doc->appMode == modeEditClip)
                setCursor(QCursor(Qt::CrossCursor));
}

void ScribusView::SelectItemNr(uint nr, bool draw, bool single)
{
        if (nr < static_cast<uint>(Doc->Items->count()))
                SelectItem(Doc->Items->at(nr), draw, single);
}

//CB-->Doc/Fix
void ScribusView::SelectItem(PageItem *currItem, bool draw, bool single)
{
        if (!currItem->isSelected())
        {
                if (single)
                {
                        Doc->m_Selection->addItem(currItem);
                        currItem->isSingleSel = true;
                        updateContents();
//                      updateContents(currItem->getRedrawBounding(m_canvas->scale()));
                }
                else
                {
                        Doc->m_Selection->addItem(currItem);
                        if (draw)
                        {
                                updateContents(currItem->getRedrawBounding(m_canvas->scale()));
                        }
                        //CB FIXME/TODO We are surely prepending here and we have turned off
                        //emitting in prepend below so do it here.
                        //Doc->m_Selection->itemAt(0)->emitAllToGUI();
                }
        }
        if (draw)
        {
                if (Doc->m_Selection->count() > 0)
                {
                        Doc->m_Selection->setGroupRect();
                        double x, y, w, h;
                        Doc->m_Selection->getGroupRect(&x, &y, &w, &h);
                        getGroupRectScreen(&x, &y, &w, &h);
                        updateContents();
        //              updateContents(QRect(static_cast<int>(x-5), static_cast<int>(y-5), static_cast<int>(w+10), static_cast<int>(h+10)));
                        //CB move in here as the emitAllToGUI will do it otherwise
                        emit ItemGeom();
                        emit HaveSel();
                }
                //CB done by addItem for single selection or the frame data is already there
                //else
                        //EmitValues(currItem);
                        //currItem->emitAllToGUI();
        }
}

//CB Remove bookmark interaction here, item/doc should do it
void ScribusView::Deselect(bool /*prop*/)
{
        if (Doc->m_Selection->isEmpty())
                return;

        const double scale = m_canvas->scale();
        PageItem* currItem = NULL;
        for (int a = 0; a < Doc->m_Selection->count(); ++a)
        {
                currItem = Doc->m_Selection->itemAt(a);
                if ((currItem->asTextFrame()) && (currItem->isBookmark))
                        emit ChBMText(currItem);
        }
        if (Doc->m_Selection->isMultipleSelection())
        {
                double x, y, w, h;
                Doc->m_Selection->getGroupRect(&x, &y, &w, &h);
                Doc->m_Selection->clear();
                updateCanvas(x - 5/scale, y - 5/scale, w + 10/scale, h + 10/scale);
        }
        else
        {
                currItem = Doc->m_Selection->itemAt(0);
                if (currItem != NULL)
                {
                        currItem->itemText.deselectAll();
                        currItem->HasSel = false;
                }
                Doc->m_Selection->clear();
                if (currItem != NULL)
                        updateContents(currItem->getRedrawBounding(scale));
        }
}

 // FIXME:av -> CanvasMode_legacy / Doc
//CB Remove emit/start pasting objects
void ScribusView::PasteToPage()
{
        UndoTransaction activeTransaction;
        int ac = Doc->Items->count();
        if (UndoManager::undoEnabled())
                activeTransaction = undoManager->beginTransaction(Doc->currentPage()->getUName(), 0, Um::Paste, "", Um::IPaste);
/*      if (ScMimeData::clipboardHasScribusFragment())
        {
                bool savedAlignGrid = Doc->SnapGrid;
                bool savedAlignGuides = Doc->SnapGuides;
                QByteArray fragment   = ScMimeData::clipboardScribusFragment();
                Selection pastedObjects = Doc->serializer()->deserializeObjects(fragment);
                Doc->SnapGrid = savedAlignGrid;
                Doc->SnapGuides = savedAlignGuides;
                pastedObjects.setGroupRect();
                double gx, gy, gh, gw;
                pastedObjects.getGroupRect(&gx, &gy, &gw, &gh);
                Doc->moveGroup(dragX - gx, dragY - gy, &pastedObjects);
                Doc->m_Selection->clear();
        }
        else
        { */

                QString buffer = ScMimeData::clipboardScribusElem();
                emit LoadElem(buffer, dragX, dragY, false, false, Doc, this);
//      }
        Doc->DraggedElem = 0;
        Doc->DragElements.clear();
        updateContents();
        Selection newObjects(this, false);
        for (int as = ac; as < Doc->Items->count(); ++as)
        {
                PageItem* currItem = Doc->Items->at(as);
                if (currItem->isBookmark)
                        emit AddBM(currItem);
                newObjects.addItem(currItem);
                currItem->LayerID = Doc->activeLayer();
        }
        if (newObjects.count() > 1)
        {
                newObjects.setGroupRect();
                double gx, gy, gh, gw;
                newObjects.getGroupRect(&gx, &gy, &gw, &gh);
                double nx = gx;
                double ny = gy;
                if (!Doc->ApplyGuides(&nx, &ny) && !Doc->ApplyGuides(&nx, &ny,true))
                {
                        FPoint npx;
                        npx = Doc->ApplyGridF(FPoint(nx, ny));
                        nx = npx.x();
                        ny = npx.y();
                }
                Doc->moveGroup(nx-gx, ny-gy, &newObjects);
                newObjects.setGroupRect();
                newObjects.getGroupRect(&gx, &gy, &gw, &gh);
                nx = gx+gw;
                ny = gy+gh;
                Doc->ApplyGuides(&nx, &ny);
                Doc->ApplyGuides(&nx, &ny,true);
                Doc->moveGroup(nx-(gx+gw), ny-(gy+gh), &newObjects);
                newObjects.setGroupRect();
                newObjects.getGroupRect(&gx, &gy, &gw, &gh);
                emit ItemGeom();
                emit HaveSel();
        }
        else if (newObjects.count() == 1)
        {
                PageItem *currItem = newObjects.itemAt(0);
                if (Doc->SnapGrid)
                {
                        double nx = currItem->xPos();
                        double ny = currItem->yPos();
                        if (!Doc->ApplyGuides(&nx, &ny) && !Doc->ApplyGuides(&nx, &ny,true))
                        {
                                FPoint npx;
                                npx = Doc->ApplyGridF(FPoint(nx, ny));
                                nx = npx.x();
                                ny = npx.y();
                        }
                        Doc->moveItem(nx-currItem->xPos(), ny-currItem->yPos(), currItem);
                }
                currItem->emitAllToGUI();
        }
        else // newObjects.count() == 0
        {
                if (activeTransaction)
                {
                        activeTransaction.cancel();
                        activeTransaction.reset();
                }
                return;
        }
        newObjects.clear();
        if (activeTransaction)
        {
                activeTransaction.commit();
                activeTransaction.reset();
        }
        emit DocChanged();
}

void ScribusView::resizeEvent ( QResizeEvent * event )
{
//      qDebug() << "ScribusView::resizeEvent";
        QScrollArea::resizeEvent(event);
        horizRuler->setGeometry(m_vhRulerHW, 1, width()-m_vhRulerHW-1, m_vhRulerHW);
        vertRuler->setGeometry(1, m_vhRulerHW, m_vhRulerHW, height()-m_vhRulerHW-1);
        rulerMover->setGeometry(1, 1, m_vhRulerHW, m_vhRulerHW);
        if (clockLabel->isExpanded())
        {
                clockLabel->setGeometry(m_vhRulerHW + 1, height() - m_vhRulerHW - 61, 60, 60);
                clockLabel->setFixedSize(60, 60);
        }
        else
        {
                clockLabel->setGeometry(m_vhRulerHW + 1, height() - m_vhRulerHW - 16, 15, 15);
                clockLabel->setFixedSize(15, 15);
        }
        endEditButton->setGeometry(m_vhRulerHW + 1, height() - m_vhRulerHW - endEditButton->minimumSizeHint().height() - 1, endEditButton->minimumSizeHint().width(), endEditButton->minimumSizeHint().height());
        m_canvas->setForcedRedraw(true);
        m_canvas->resetRenderMode();
        // Per Qt doc, not painting should be done in a resizeEvent,
        // a paint event will be emitted right afterwards
        // m_canvas->update();
}

void ScribusView::setHBarGeometry(QScrollBar &bar, int x, int y, int w, int h)
{
        bar.setGeometry(x, y, w, h);
        if (Ready)
                horizRuler->setGeometry(m_vhRulerHW, 1, w-m_vhRulerHW-1, m_vhRulerHW);
}

void ScribusView::setVBarGeometry(QScrollBar &bar, int x, int y, int w, int h)
{
        bar.setGeometry(x, y, w, h);
        if (Ready)
        {
                vertRuler->setGeometry(1, m_vhRulerHW, m_vhRulerHW, h-m_vhRulerHW-1);
                rulerMover->setGeometry(1, 1, m_vhRulerHW, m_vhRulerHW);
        }
}

bool ScribusView::mousePressed()
{
        return m_canvas->m_viewMode.m_MouseButtonPressed;
}

void ScribusView::resetMousePressed()
{
        m_canvas->m_viewMode.m_MouseButtonPressed = false;
}


void ScribusView::startGroupTransaction(const QString& action, const QString& description, QPixmap* actionIcon, Selection* customSelection)
{
        Selection* itemSelection = (customSelection!=0) ? customSelection : Doc->m_Selection;
        assert(itemSelection!=0);
        uint selectedItemCount=itemSelection->count();
        Q_ASSERT(selectedItemCount > 0);
        if (!m_groupTransaction)
        {
                QString tooltip = description;
                QString target = Um::SelectionGroup;
                QPixmap* targetIcon = Um::IGroup;
                if (tooltip.isEmpty() && selectedItemCount > 1)
                {
                        if (selectedItemCount <= Um::ItemsInvolvedLimit)
                        {
                                tooltip = Um::ItemsInvolved + "\n";
                                for (uint i = 0; i < selectedItemCount; ++i)
                                        tooltip += "\t" + itemSelection->itemAt(i)->getUName() + "\n";
                        }
                        else
                        {
                                tooltip = Um::ItemsInvolved2 + "\n";
                        }
                }
                if (selectedItemCount == 1)
                {
                        target = itemSelection->itemAt(0)->getUName();
                        targetIcon = itemSelection->itemAt(0)->getUPixmap();
                }
                m_groupTransaction = undoManager->beginTransaction(target, targetIcon,
                                                                                                                   action, tooltip, actionIcon);
        }
        ++m_groupTransactions;
}


/**

*/

void ScribusView::endGroupTransaction()
{
        if (m_groupTransactions > 0)
        {
                --m_groupTransactions;
        }
        if (m_groupTransaction && m_groupTransactions == 0)
        {
                m_groupTransaction.commit();
                m_groupTransaction.reset();
        }
}

/**
   Always cancels the toplevel transaction and all enclosed ones
 */

void ScribusView::cancelGroupTransaction()
{
        if (m_groupTransaction && m_groupTransactions == 1)
        {
                m_groupTransaction.cancel();
                m_groupTransaction.reset();
        }
        else if (m_groupTransaction)
        {
                m_groupTransaction.markFailed();
        }
        if (m_groupTransactions > 0)
                --m_groupTransactions;
}


// jjsa 27-03-2004 add for better setting while zooming
//CB find a new name
void ScribusView::rememberOldZoomLocation(int mx, int my)
{
        oldX = mx;
        oldY = my;
}

void ScribusView::setRulerPos(int x, int y)
{
        if (m_ScMW->scriptIsRunning())
                return;
        if (Doc->guidesPrefs().rulerMode)
        {
                horizRuler->shift(x / m_canvas->scale() - Doc->currentPage()->xOffset());
                vertRuler->shift(y / m_canvas->scale() - Doc->currentPage()->yOffset());
        }
        else
        {
                horizRuler->shift(x / m_canvas->scale());
                vertRuler->shift(y / m_canvas->scale());
        }
//      horizRuler->offs += qRound(Doc->minCanvasCoordinate.x() - 1 - Doc->rulerXoffset);
//      vertRuler->offs += qRound(Doc->minCanvasCoordinate.y() - 1 - Doc->rulerYoffset);
        horizRuler->shiftRel(0*Doc->minCanvasCoordinate.x()  - Doc->rulerXoffset);
        vertRuler->shiftRel(0*Doc->minCanvasCoordinate.y()  - Doc->rulerYoffset);
        horizRuler->update();
        vertRuler->update();
//      evSpon = true;
        QString newStatusBarText(" ");
        if ((verticalScrollBar()->isSliderDown()) || (horizontalScrollBar()->isSliderDown()))
        {
                QList<int> pag;
                pag.clear();
                uint docPageCount=Doc->Pages->count();
                for (uint a = 0; a < docPageCount; ++a)
                {
                        int xs = static_cast<int>(Doc->Pages->at(a)->xOffset() * m_canvas->scale());
                        int ys = static_cast<int>(Doc->Pages->at(a)->yOffset() * m_canvas->scale());
                        int ws = static_cast<int>(Doc->Pages->at(a)->width() * m_canvas->scale());
                        int hs = static_cast<int>(Doc->Pages->at(a)->height() * m_canvas->scale());
                        QRect drawRect = QRect(x, y, visibleWidth(), visibleHeight());
//                      drawRect.moveBy(qRound(-Doc->minCanvasCoordinate.x() * m_canvas->scale()), qRound(-Doc->minCanvasCoordinate.y() * m_canvas->scale()));
                        if (drawRect.intersects(QRect(xs, ys, ws, hs)))
                                pag.append(a+1);
                }
                if (!pag.isEmpty())
                        newStatusBarText=( tr("Page %1 to %2").arg(pag.first()).arg(pag.last()));
        }
        m_ScMW->setStatusBarInfoText(newStatusBarText);
}


//CB This MUST now be called AFTER a call to doc->addPage or doc->addMasterPage as it
//does NOT create a page anymore.
ScPage* ScribusView::addPage(int nr, bool mov)
{
        ScPage* fe=Doc->Pages->at(nr);
        Q_ASSERT(fe!=0);
        if (fe==0)
                return 0;
        //Note this picks up the new page or master page depending on the mode.
//      reformPages(mov);
        Doc->reformPages(mov);
        m_ScMW->slotSetCurrentPage(nr);
        m_canvas->m_viewMode.m_MouseButtonPressed = false;
        Doc->DragP = false;
        Doc->leaveDrag = false;
        m_canvas->m_viewMode.operItemMoving = false;
        MidButt = false;
        HaveSelRect = false;
        Magnify = false;
        Doc->nodeEdit.setEdPoints(true);
        DraggedGroup = false;
//FIXME:av      MoveGY = false;
//FIXME:av      MoveGX = false;
        Doc->nodeEdit.setIsContourLine(false);
        return fe;
}

void ScribusView::reformPages(bool moveObjects)
{
        Doc->reformPages(moveObjects);
        reformPagesView();
}

void ScribusView::reformPagesView()
{
        if (!m_ScMW->scriptIsRunning())
                setContentsPos(qRound((Doc->currentPage()->xOffset()-10 - 0*Doc->minCanvasCoordinate.x()) * m_canvas->scale()), qRound((Doc->currentPage()->yOffset()-10 - 0*Doc->minCanvasCoordinate.y()) * m_canvas->scale()));
        if (!Doc->isLoading())
        {
                setRulerPos(contentsX(), contentsY());
                m_ScMW->slotSetCurrentPage(Doc->currentPage()->pageNr());
        }
}

void ScribusView::updatesOn(bool on)
{
        updateOn = on;
        setUpdatesEnabled(on);
        viewport()->setUpdatesEnabled(on);
}


/*!
  paints the canvas inside the box given in canvas coordinates
 */

void ScribusView::updateCanvas(QRectF box)
{
        if (box.isValid())
        {
                QPoint upperLeft = m_canvas->canvasToLocal(box.topLeft());
                QPoint lowerRight = m_canvas->canvasToLocal(box.bottomRight());
                upperLeft.setX(qMax(0, upperLeft.x()-10));
                upperLeft.setY(qMax(0, upperLeft.y()-10));
                lowerRight.setX(qMax(0, lowerRight.x()+10));
                lowerRight.setY(qMax(0, lowerRight.y()+10));
//              qDebug() << "updateCanvas:" << upperLeft << lowerRight;
                m_canvas->update(upperLeft.x(), upperLeft.y(), lowerRight.x()-upperLeft.x(), lowerRight.y()-upperLeft.y());
/*              double scale = m_canvas->scale();
                double x = box.x() * scale;
                double y = box.y() * scale;
                double w = box.width() * scale;
                double h = box.height() * scale;
                double sbx = horizontalScrollBar()->value();
                double sby = verticalScrollBar()->value();
                if (x < sbx)
                {
                        w -= (sbx - x);
                        x = sbx;
                }
                else
                {
                        w += (x - static_cast<int>(x));  // since x will be rounded down below
                }
                if (y < sby)
                {
                        h -= (sby - y);
                        y = sby;
                }
                else
                {
                        h += (y - static_cast<int>(y));  // since y will be rounded down below
                }
                // enlarge the rectangle when rounding to int:
                m_canvas->update(static_cast<int>(x), static_cast<int>(y),
                                                 qMin(qRound(h + 0.5), viewport()->width()),
                                                 qMin(qRound(w + 0.5), viewport()->height()));
*/
      }
        else
        {
                m_canvas->update(horizontalScrollBar()->value(), verticalScrollBar()->value(), viewport()->width(), viewport()->height());
        }
}


/*!
  Scrolls the canvas so (x,y) becomes the origin
 */

void ScribusView::setCanvasOrigin(double x, double y)
{
        double scale = m_canvas->scale();
        horizontalScrollBar()->setValue(qRound(x * scale));
        verticalScrollBar()->setValue(qRound(y * scale));
        // fix ranges
        QSize maxViewport = maximumViewportSize();
        horizontalScrollBar()->setRange(qRound(Doc->minCanvasCoordinate.x() * scale),
                                                                        qRound(Doc->maxCanvasCoordinate.x() * scale) - maxViewport.width());
        verticalScrollBar()->setRange(qRound(Doc->minCanvasCoordinate.y() * scale),
                                                                  qRound(Doc->maxCanvasCoordinate.y() * scale) - maxViewport.height());
}


/*!
  Scrolls the canvas so (x,y) is in the center of the viewport
 */

void ScribusView::setCanvasCenter(double x, double y)
{
        double scale = m_canvas->scale();
        setCanvasOrigin(x - viewport()->width() / scale,
                                        y - viewport()->height() / scale);
}

/*!
  Scrolls canvas relatively
 */

void ScribusView::scrollCanvasBy(double deltaX, double deltaY)
{
        double scale = m_canvas->scale();
        horizontalScrollBar()->setValue(qRound(horizontalScrollBar()->value() + deltaX * scale));
        verticalScrollBar()->setValue(qRound(verticalScrollBar()->value() + deltaX * scale));
}


/*!
  returns the canvas's origin in canvas coordinates.
  Doc->minCanvasCoordinate <= result <= Doc->maxCanvasCoordinate
 */

FPoint ScribusView::canvasOrigin() const
{
        double scale = m_canvas->scale();
        return FPoint(horizontalScrollBar()->value() / scale, verticalScrollBar()->value() / scale);
}


/*!
  returns the visible part of the canvas in canvas coordinates
 */

QRectF ScribusView::visibleCanvas() const
{
        double scale = m_canvas->scale();
        return QRectF(horizontalScrollBar()->value() / scale,
                                  verticalScrollBar()->value() / scale,
                                  viewport()->width() / scale,
                                  viewport()->height() / scale);
}


/*!
  Legacy.
  Now ignores the parameters and just adjusts the canvas widget according to min/maxCanvasCoordinate
 */

/*
void ScribusView::adjustCanvas(double width, double height, double dX, double dY)
{
        QSize maxViewport = maximumViewportSize();
        double scale = m_canvas->scale();
        horizontalScrollBar()->setRange(qRound(Doc->minCanvasCoordinate.x() * scale),
                                                                        qRound(Doc->maxCanvasCoordinate.x() * scale) - maxViewport.width());
        verticalScrollBar()->setRange(qRound(Doc->minCanvasCoordinate.y() * scale),
                                                                  qRound(Doc->maxCanvasCoordinate.y() * scale) - maxViewport.height());
//      qDebug() << "adjustCanvas" << width << height << dX << dY
//              << "(" << Doc->minCanvasCoordinate.x() << Doc->minCanvasCoordinate.y() << ") - ("
//              << Doc->maxCanvasCoordinate.x() << Doc->maxCanvasCoordinate.y() << ") @" << scale << maxViewport;
        widget()->resize(qRound((Doc->maxCanvasCoordinate.x()-Doc->minCanvasCoordinate.x())*scale),
                                   qRound((Doc->maxCanvasCoordinate.y()-Doc->minCanvasCoordinate.y())*scale));

        if (false && !m_canvas->m_viewMode.operItemMoving)
        {
                bool updback = updateOn;
                updatesOn(false);
                int oldDX = contentsX();
                int oldDY = contentsY();
                int nw = qMax(qRound(width * scale), contentsWidth() + qRound(dX * scale) * 2);
                int nh = qMax(qRound(height * scale), contentsHeight() + qRound(dY * scale) * 2);
                resizeContents(qMax(nw, visibleWidth() + qRound(dX * scale) * 2), qMax(nh, visibleHeight() + qRound(dY * scale) * 2));
                setContentsPos(oldDX + qRound(dX * scale), oldDY + qRound(dY * scale));
//              setRulerPos(contentsX(), contentsY());
                updatesOn(updback);
        }
//      evSpon = false;
}*/


void ScribusView::setZoom()
{
        int x = qRound(qMax(contentsX() / m_canvas->scale(), 0.0));
        int y = qRound(qMax(contentsY() / m_canvas->scale(), 0.0));
        int w = qRound(qMin(visibleWidth() / m_canvas->scale(), Doc->currentPage()->width()));
        int h = qRound(qMin(visibleHeight() / m_canvas->scale(), Doc->currentPage()->height()));
        rememberOldZoomLocation(w / 2 + x,h / 2 + y);
        zoom(oldX, oldY, m_ScMW->zoomSpinBox->value() / 100.0 * Prefs->displayPrefs.displayScale, false);
        setFocus();
}

void ScribusView::slotZoom100()
{
        int x = qRound(qMax(contentsX() / m_canvas->scale(), Doc->minCanvasCoordinate.x()));
        int y = qRound(qMax(contentsY() / m_canvas->scale(), Doc->minCanvasCoordinate.y()));
        int w = qRound(qMin(visibleWidth() / m_canvas->scale(), Doc->maxCanvasCoordinate.x() - Doc->minCanvasCoordinate.x()));
        int h = qRound(qMin(visibleHeight() / m_canvas->scale(), Doc->maxCanvasCoordinate.y() - Doc->minCanvasCoordinate.y()));
        rememberOldZoomLocation(w / 2 + x,h / 2 + y);
        zoom(oldX, oldY, Prefs->displayPrefs.displayScale, false);
}

void ScribusView::slotZoomIn(int mx,int my)
{
        // FIXME : mx and my should really be ScribusView local coordinates or global coordinates
        if ((mx == 0) && (my == 0))
        {
                int x = qRound(qMax(contentsX() / m_canvas->scale(), Doc->minCanvasCoordinate.x()));
                int y = qRound(qMax(contentsY() / m_canvas->scale(), Doc->minCanvasCoordinate.y()));
                int w = qRound(qMin(visibleWidth() / m_canvas->scale(), Doc->maxCanvasCoordinate.x() - Doc->minCanvasCoordinate.x()));
                int h = qRound(qMin(visibleHeight() / m_canvas->scale(), Doc->maxCanvasCoordinate.y() - Doc->minCanvasCoordinate.y()));
                rememberOldZoomLocation(w/2+x, h/2+y);
        }
        else
                rememberOldZoomLocation(mx,my);
        double newScale = m_canvas->scale() * (1 + static_cast<double>(Doc->opToolPrefs().magStep)/100.0);
        if(static_cast<int>(newScale*100)>static_cast<int>(100 * static_cast<double>(Doc->opToolPrefs().magStep)*Prefs->displayPrefs.displayScale/100))
                newScale = m_canvas->scale() + static_cast<double>(Doc->opToolPrefs().magStep)*Prefs->displayPrefs.displayScale/100;
        if (Doc->m_Selection->count() != 0)
        {
                PageItem *currItem = Doc->m_Selection->itemAt(0);
                double zPointX = currItem->xPos() + currItem->width() / 2.0;
                double zPointY = currItem->yPos() + currItem->height() / 2.0;
                zoom( qRound(zPointX), qRound(zPointY), newScale, false);
        }
        else
                zoom(oldX, oldY, newScale, true);
}

/** Verkleinert die Ansicht */
void ScribusView::slotZoomOut(int mx,int my)
{
        // FIXME : mx and my should really be ScribusView local coordinates or global coordinates
        if ((mx == 0) && (my == 0))
        {
                int x = qRound(qMax(contentsX() / m_canvas->scale(), Doc->minCanvasCoordinate.x()));
                int y = qRound(qMax(contentsY() / m_canvas->scale(), Doc->minCanvasCoordinate.y()));
                int w = qRound(qMin(visibleWidth() / m_canvas->scale(), Doc->maxCanvasCoordinate.x() - Doc->minCanvasCoordinate.x()));
                int h = qRound(qMin(visibleHeight() / m_canvas->scale(), Doc->maxCanvasCoordinate.y() - Doc->minCanvasCoordinate.y()));
                rememberOldZoomLocation(w/2+x, h/2+y);
        }
        else
                rememberOldZoomLocation(mx,my);
        double newScale = m_canvas->scale() - static_cast<double>(Doc->opToolPrefs().magStep)*Prefs->displayPrefs.displayScale/100;
        if(newScale<=Prefs->displayPrefs.displayScale/100)
                newScale = m_canvas->scale() / (1 + static_cast<double>(Doc->opToolPrefs().magStep)/100.0);
        if(newScale<=Prefs->displayPrefs.displayScale/100)
                newScale = m_canvas->scale();
        if (Doc->m_Selection->count() != 0)
        {
                PageItem *currItem = Doc->m_Selection->itemAt(0);
                double zPointX = currItem->xPos() + currItem->width() / 2.0;
                double zPointY = currItem->yPos() + currItem->height() / 2.0;
                zoom( qRound(zPointX), qRound(zPointY), newScale, false);
        }
        else
                zoom(oldX, oldY, newScale, true);
}

#if 0
FPoint ScribusView::translateToView(double x, double y) // deprecated
{
        return FPoint((x - 0*Doc->minCanvasCoordinate.x()) * m_canvas->scale(), (y - 0*Doc->minCanvasCoordinate.y())* m_canvas->scale());
}

FPoint ScribusView::translateToView(FPoint in) // deprecated
{
        return translateToView(in.x(), in.y());
}

FPoint ScribusView::translateToDoc(double x, double y) // deprecated
{
        return FPoint(x / m_canvas->scale() + 0*Doc->minCanvasCoordinate.x(), y / m_canvas->scale() + 0*Doc->minCanvasCoordinate.y());
}

FPoint ScribusView::translateToDoc(FPoint in) // deprecated
{
        return translateToDoc(in.x(), in.y());
}

FPoint ScribusView::translateFromViewport(double x, double y) // deprecated
{
        return FPoint((x + contentsX()) / m_canvas->scale() + 0*Doc->minCanvasCoordinate.x(), (y + contentsY()) / m_canvas->scale() + 0*Doc->minCanvasCoordinate.y());
}

FPoint ScribusView::translateFromViewport(FPoint in) // deprecated
{
        return translateFromViewport(in.x(), in.y());
}

FPoint ScribusView::translateToViewport(double x, double y) // deprecated
{
        return FPoint((x - 0*Doc->minCanvasCoordinate.x()) * m_canvas->scale() - contentsX(), (y - 0*Doc->minCanvasCoordinate.y())* m_canvas->scale() - contentsY());
}

FPoint ScribusView::translateToViewport(FPoint in) // deprecated
{
        return translateToViewport(in.x(), in.y());
}
#endif


void ScribusView::DrawNew()
{
//      qDebug("ScribusView::DrawNew");
//      printBacktrace(24);
        if (m_ScMW->scriptIsRunning())
                return;
        m_canvas->setForcedRedraw(true);
        m_canvas->resetRenderMode();
        updateContents();
        setRulerPos(contentsX(), contentsY());
        m_ScMW->slotSetCurrentPage(Doc->currentPage()->pageNr());
//      disconnect(m_ScMW->zoomSpinBox, SIGNAL(valueChanged(double)), this, SLOT(setZoom()));
//      m_ScMW->zoomSpinBox->setValue(m_canvas->scale()/Prefs->displayPrefs.displayScale*100);
//      connect(m_ScMW->zoomSpinBox, SIGNAL(valueChanged(double)), this, SLOT(setZoom()));
}

void ScribusView::SetCCPo(double x, double y)
{
        if (m_ScMW->scriptIsRunning())
                return;
        QPoint nx = m_canvas->canvasToLocal(FPoint(x, y));
        QSize viewsize = viewport()->size();
//      qDebug() << "setCCPo" << nx << viewsize;
        setContentsPos(nx.x() - viewsize.width() / 2, nx.y() - viewsize.height() / 2);
}

void ScribusView::SetCPo(double x, double y)
{
        if (m_ScMW->scriptIsRunning())
                return;
        QPoint nx = m_canvas->canvasToLocal(FPoint(x, y));
        setContentsPos(nx.x(), nx.y());
}

void ScribusView::GotoLa(int l)
{
        int level = Doc->layerCount()-l-1;
        int layerID=Doc->layerIDFromLevel(level);
        if (layerID==-1)
                return;
        Doc->setActiveLayer(layerID);
        //CB TODO fix this to use view calls after 1.3.2 release
        m_ScMW->changeLayer(Doc->activeLayer());
        emit changeLA(layerID);
}

void ScribusView::ChgUnit(int art)
{
        emit changeUN(art);
        unitChange();
        vertRuler->update();
        horizRuler->update();
}


void ScribusView::GotoPa(int Seite)
{
        Deselect();
        GotoPage(Seite-1);
        setFocus();
}

void ScribusView::GotoPage(int Seite)
{
        Doc->setCurrentPage(Doc->Pages->at(Seite));
        if (m_ScMW->scriptIsRunning())
                return;
        m_ScMW->slotSetCurrentPage(Seite);
        SetCPo(Doc->currentPage()->xOffset() - 10, Doc->currentPage()->yOffset() - 10);
        m_ScMW->HaveNewSel();
}

void ScribusView::showMasterPage(int nr)
{
        // #9684 : we need Deselect() to emit HaveSel() when switching masterpage
        Deselect(true);
        OldScale = m_canvas->scale();
        if (!Doc->masterPageMode())
                this->requestMode(modeNormal);
        Doc->setMasterPageMode(true);
        Doc->setCurrentPage(Doc->Pages->at(nr));
        m_ScMW->pageSelector->setEnabled(false);
        updateOn = false;
        zoom();
        oldX = qRound(Doc->currentPage()->xOffset()- 10);
        oldY = qRound(Doc->currentPage()->yOffset()- 10);
        SetCPo(Doc->currentPage()->xOffset() - 10, Doc->currentPage()->yOffset() - 10);
        updateOn = true;
        endEditButton->setVisible(true);
        DrawNew();
}

void ScribusView::hideMasterPage()
{
        Deselect(true);
        if (Doc->masterPageMode())
                this->requestMode(modeNormal);
        Doc->setMasterPageMode(false);
        m_ScMW->pageSelector->setEnabled(true);
        endEditButton->setVisible(false);
        resizeContents(qRound((Doc->maxCanvasCoordinate.x() - Doc->minCanvasCoordinate.x()) * m_canvas->scale()), qRound((Doc->maxCanvasCoordinate.y() - Doc->minCanvasCoordinate.y()) * m_canvas->scale()));
}

void ScribusView::showSymbolPage(QString symbolName)
{
        Deselect(false);
        OldScale = m_canvas->scale();
        if (!Doc->symbolEditMode())
                this->requestMode(modeNormal);
        Doc->setSymbolEditMode(true, symbolName);
        Doc->setCurrentPage(Doc->Pages->at(0));
        m_ScMW->pageSelector->setEnabled(false);
        m_ScMW->layerMenu->setEnabled(false);
        updateOn = false;
        zoom();
        oldX = qRound(Doc->currentPage()->xOffset()- 10);
        oldY = qRound(Doc->currentPage()->yOffset()- 10);
        SetCPo(Doc->currentPage()->xOffset() - 10, Doc->currentPage()->yOffset() - 10);
        updateOn = true;
        endEditButton->setVisible(true);
        DrawNew();
}

void ScribusView::hideSymbolPage()
{
        updatesOn(false);
        Deselect(true);
        if (Doc->symbolEditMode())
                this->requestMode(modeNormal);
        Doc->setSymbolEditMode(false);
        updatesOn(true);
        endEditButton->setVisible(false);
        Doc->setCurrentPage(Doc->Pages->at(0));
        m_ScMW->pageSelector->setEnabled(true);
        m_ScMW->layerMenu->setEnabled(true);
        resizeContents(qRound((Doc->maxCanvasCoordinate.x() - Doc->minCanvasCoordinate.x()) * m_canvas->scale()), qRound((Doc->maxCanvasCoordinate.y() - Doc->minCanvasCoordinate.y()) * m_canvas->scale()));
}

void ScribusView::showInlinePage(int id)
{
        Deselect(false);
        OldScale = m_canvas->scale();
        if (!Doc->inlineEditMode())
                this->requestMode(modeNormal);
        Doc->setInlineEditMode(true, id);
        Doc->setCurrentPage(Doc->Pages->at(0));
        m_ScMW->pageSelector->setEnabled(false);
        m_ScMW->layerMenu->setEnabled(false);
        updateOn = false;
        zoom();
        oldX = qRound(Doc->currentPage()->xOffset()- 10);
        oldY = qRound(Doc->currentPage()->yOffset()- 10);
        SetCPo(Doc->currentPage()->xOffset() - 10, Doc->currentPage()->yOffset() - 10);
        updateOn = true;
        endEditButton->setVisible(true);
        DrawNew();
}

void ScribusView::hideInlinePage()
{
        updatesOn(false);
        Deselect(true);
        if (Doc->inlineEditMode())
                this->requestMode(modeNormal);
        Doc->setInlineEditMode(false);
        updatesOn(true);
        endEditButton->setVisible(false);
        Doc->setCurrentPage(Doc->Pages->at(0));
        m_ScMW->pageSelector->setEnabled(true);
        m_ScMW->layerMenu->setEnabled(true);
        resizeContents(qRound((Doc->maxCanvasCoordinate.x() - Doc->minCanvasCoordinate.x()) * m_canvas->scale()), qRound((Doc->maxCanvasCoordinate.y() - Doc->minCanvasCoordinate.y()) * m_canvas->scale()));
}

QImage ScribusView::MPageToPixmap(QString name, int maxGr, bool drawFrame)
{
        QImage pm;
        QImage im;
        ScLayer layer;
        layer.isViewable = false;
        int Nr = Doc->MasterNames[name];
        int clipx = static_cast<int>(Doc->scratch()->left());
        int clipy = static_cast<int>(Doc->scratch()->top());
        int clipw = qRound(Doc->MasterPages.at(Nr)->width());
        int cliph = qRound(Doc->MasterPages.at(Nr)->height());
        if ((clipw > 0) && (cliph > 0))
        {
                double sca = m_canvas->scale();
                bool frs = Doc->guidesPrefs().framesShown;
                double cx = Doc->minCanvasCoordinate.x();
                double cy = Doc->minCanvasCoordinate.y();
                Doc->minCanvasCoordinate = FPoint(0, 0);
                ScPage* act = Doc->currentPage();
                bool mMode = Doc->masterPageMode();
                Doc->setMasterPageMode(true);
                Doc->setCurrentPage(Doc->MasterPages.at(Nr));
                bool ctrls = Doc->guidesPrefs().showControls;
                Doc->guidesPrefs().showControls = false;
                Doc->guidesPrefs().framesShown = false;
                setScale(1.0);
                m_canvas->setPreviewMode(true);
                m_canvas->setForcedRedraw(true);
                pm = QImage(clipw, cliph, QImage::Format_ARGB32_Premultiplied);
                ScPainter *painter = new ScPainter(&pm, pm.width(), pm.height(), 1.0, 0);
                painter->clear(Doc->paperColor());
                painter->translate(-clipx, -clipy);
                painter->setLineWidth(1);
                if (drawFrame)
                {
                        painter->setPen(Qt::black, 1, Qt::SolidLine, Qt::FlatCap, Qt::MiterJoin);
                        painter->setBrush(Doc->paperColor());
                        painter->drawRect(clipx, clipy, clipw, cliph);
                }
                painter->beginLayer(1.0, 0);
                int layerCount = Doc->layerCount();
                for (int layerLevel = 0; layerLevel < layerCount; ++layerLevel)
                {
                        Doc->Layers.levelToLayer(layer, layerLevel);
                        m_canvas->DrawPageItems(painter, layer, QRect(clipx, clipy, clipw, cliph), false);
                        m_canvas->DrawPageItems(painter, layer, QRect(clipx, clipy, clipw, cliph), true);
                }
                painter->endLayer();
                painter->end();
                double sx = pm.width() / static_cast<double>(maxGr);
                double sy = pm.height() / static_cast<double>(maxGr);
                if (sy < sx)
                        im = pm.scaled(static_cast<int>(pm.width() / sx), static_cast<int>(pm.height() / sx), Qt::IgnoreAspectRatio, Qt::SmoothTransformation);
                else
                        im = pm.scaled(static_cast<int>(pm.width() / sy), static_cast<int>(pm.height() / sy), Qt::IgnoreAspectRatio, Qt::SmoothTransformation);
                delete painter;
                painter=NULL;
                m_canvas->setPreviewMode(false);
                m_canvas->setForcedRedraw(false);
                Doc->guidesPrefs().framesShown = frs;
                Doc->guidesPrefs().showControls = ctrls;
                setScale(sca);
                Doc->setMasterPageMode(mMode);
                Doc->setCurrentPage(act);
                Doc->minCanvasCoordinate = FPoint(cx, cy);
        }
        return im;
}

QImage ScribusView::PageToPixmap(int Nr, int maxGr, bool drawFrame, bool drawBackground)
{
        QImage im;
        double sx = maxGr / Doc->DocPages.at(Nr)->width();
        double sy = maxGr / Doc->DocPages.at(Nr)->height();
        double sc = qMin(sx, sy);
        int clipx = static_cast<int>(Doc->DocPages.at(Nr)->xOffset() * sc);
        int clipy = static_cast<int>(Doc->DocPages.at(Nr)->yOffset() * sc);
        int clipw = qRound(Doc->DocPages.at(Nr)->width() * sc);
        int cliph = qRound(Doc->DocPages.at(Nr)->height() * sc);
        if ((clipw <=0) || (cliph <= 0))
                return im;
        im = QImage(clipw, cliph, QImage::Format_ARGB32_Premultiplied);
        if (im.isNull())
                return im;
        im.fill( qRgba(0, 0, 0, 0) );
        int oldAppMode = Doc->appMode;
        requestMode(modeNormal);
        double oldScale = m_canvas->scale();
        double cx = Doc->minCanvasCoordinate.x();
        double cy = Doc->minCanvasCoordinate.y();
        Doc->minCanvasCoordinate = FPoint(0, 0);
        bool oldFramesShown  = Doc->guidesPrefs().framesShown;
        bool oldShowControls = Doc->guidesPrefs().showControls;
        bool oldDrawAsPreview = Doc->drawAsPreview;
        Doc->guidesPrefs().framesShown = false;
        Doc->guidesPrefs().showControls = false;
        bool cmsCorr = false;
        if ((Doc->cmsSettings().CMSinUse) && (Doc->cmsSettings().GamutCheck))
        {
                cmsCorr = true;
                Doc->cmsSettings().GamutCheck = false;
                Doc->enableCMS(true);
        }
        Doc->drawAsPreview = true;
        m_canvas->setScale(sc);
        m_canvas->setPreviewMode(true);
        m_canvas->setForcedRedraw(true);
        ScPage* act = Doc->currentPage();
        bool mMode = Doc->masterPageMode();
        Doc->setMasterPageMode(false);
        Doc->setLoading(true);
        Doc->setCurrentPage(Doc->DocPages.at(Nr));
        ScPainter *painter = new ScPainter(&im, im.width(), im.height(), 1.0, 0);
        if (drawBackground)
                painter->clear(Doc->paperColor());
        painter->translate(-clipx, -clipy);
        painter->setFillMode(ScPainter::Solid);
        if (drawFrame)
        {
                painter->setPen(Qt::black, 1, Qt::SolidLine, Qt::FlatCap, Qt::MiterJoin);
                painter->setBrush(Doc->paperColor());
                painter->drawRect(clipx, clipy, clipw, cliph);
        }
        painter->beginLayer(1.0, 0);
        painter->setZoomFactor(m_canvas->scale());

        QList<QPair<PageItem*, int> > changedList;
        ScPage* page = Doc->DocPages.at(Nr);
        PageItem* currItem;
        if (page->FromMaster.count() != 0)
        {
                uint pageFromMasterCount = page->FromMaster.count();
                for (uint a = 0; a < pageFromMasterCount; ++a)
                {
                        currItem = page->FromMaster.at(a);
                        if (!currItem->asImageFrame() || !currItem->imageIsAvailable)
                                continue;
                        if (currItem->pixm.imgInfo.lowResType == 0)
                                continue;
                        changedList.append(qMakePair(currItem, currItem->pixm.imgInfo.lowResType));
                        currItem->pixm.imgInfo.lowResType = 0;
                        int fho = currItem->imageFlippedH();
                        int fvo = currItem->imageFlippedV();
                        double imgX = currItem->imageXOffset();
                        double imgY = currItem->imageYOffset();
                        Doc->loadPict(currItem->Pfile, currItem, true);
                        currItem->setImageFlippedH(fho);
                        currItem->setImageFlippedV(fvo);
                        currItem->setImageXOffset(imgX);
                        currItem->setImageYOffset(imgY);
                }
        }
        if (Doc->Items->count() != 0)
        {
                FPoint orig = m_canvas->localToCanvas(QPoint(clipx, clipy));
                QRectF cullingArea = QRectF(orig.x(), orig.y(), qRound(clipw / sc + 0.5), qRound(cliph / sc + 0.5));
                for (int it = 0; it < Doc->Items->count(); ++it)
                {
                        currItem = Doc->Items->at(it);
                        if (!cullingArea.intersects(currItem->getBoundingRect().adjusted(0.0, 0.0, 1.0, 1.0)))
                                continue;
                        if (!currItem->asImageFrame() || !currItem->imageIsAvailable)
                                continue;
                        if (currItem->pixm.imgInfo.lowResType == 0)
                                continue;
                        changedList.append(qMakePair(currItem, currItem->pixm.imgInfo.lowResType));
                        currItem->pixm.imgInfo.lowResType = 0;
                        int fho = currItem->imageFlippedH();
                        int fvo = currItem->imageFlippedV();
                        double imgX = currItem->imageXOffset();
                        double imgY = currItem->imageYOffset();
                        Doc->loadPict(currItem->Pfile, currItem, true);
                        currItem->setImageFlippedH(fho);
                        currItem->setImageFlippedV(fvo);
                        currItem->setImageXOffset(imgX);
                        currItem->setImageYOffset(imgY);
                }
        }

        ScLayer layer;
        layer.isViewable = false;
        int layerCount = Doc->layerCount();
        for (int layerLevel = 0; layerLevel < layerCount; ++layerLevel)
        {
                Doc->Layers.levelToLayer(layer, layerLevel);
                m_canvas->DrawMasterItems(painter, Doc->DocPages.at(Nr), layer, QRect(clipx, clipy, clipw, cliph));
                m_canvas->DrawPageItems(painter, layer, QRect(clipx, clipy, clipw, cliph), false);
                m_canvas->DrawPageItems(painter, layer, QRect(clipx, clipy, clipw, cliph), true);
        }
        painter->endLayer();
        painter->end();
        delete painter;
        painter=NULL;

        if (changedList.count() != 0)
        {
                QPair<PageItem*, int> itemPair;
                for (int it = 0; it < changedList.count(); it++)
                {
                        itemPair = changedList.at(it);
                        currItem = itemPair.first;
                        currItem->pixm.imgInfo.lowResType = itemPair.second;
                        int fho = currItem->imageFlippedH();
                        int fvo = currItem->imageFlippedV();
                        double imgX = currItem->imageXOffset();
                        double imgY = currItem->imageYOffset();
                        Doc->loadPict(currItem->Pfile, currItem, true);
                        currItem->setImageFlippedH(fho);
                        currItem->setImageFlippedV(fvo);
                        currItem->setImageXOffset(imgX);
                        currItem->setImageYOffset(imgY);
                }
        }
        if (cmsCorr)
        {
                Doc->cmsSettings().GamutCheck = true;
                Doc->enableCMS(true);
        }
        Doc->drawAsPreview = oldDrawAsPreview;
        Doc->guidesPrefs().framesShown  = oldFramesShown;
        Doc->guidesPrefs().showControls = oldShowControls;
        m_canvas->setScale(oldScale);
        Doc->setMasterPageMode(mMode);
        Doc->setCurrentPage(act);
        Doc->setLoading(false);
        m_canvas->setPreviewMode(Doc->drawAsPreview);
        m_canvas->setForcedRedraw(false);
        Doc->minCanvasCoordinate = FPoint(cx, cy);
        requestMode(oldAppMode);
        return im;
}
#if 0
void ScribusView::rulerMove(QMouseEvent *m)
{
        QPoint py(viewport()->mapFromGlobal(m->globalPos()));
        int newY = py.y();
        int newX = py.x();
        QPoint out = viewportToContents(py);
        emit MousePos((py.x() + contentsX())/m_canvas->scale(), (py.y() + contentsY())/m_canvas->scale());
        horizRuler->Draw(out.x());
        vertRuler->Draw(out.y());
        m_canvas->newRedrawPolygon() << QPoint(newX, newY);
        updateContents();
}
#endif

void ScribusView::setNewRulerOrigin(QMouseEvent *m)
{
        QPoint py = viewport()->mapFromGlobal(m->globalPos());
        Doc->rulerXoffset = (py.x() + contentsX()) / m_canvas->scale() + 0*Doc->minCanvasCoordinate.x();
        Doc->rulerYoffset = (py.y() + contentsY()) / m_canvas->scale() + 0*Doc->minCanvasCoordinate.y();
        if (Doc->guidesPrefs().rulerMode)
        {
                Doc->rulerXoffset -= Doc->currentPage()->xOffset();
                Doc->rulerYoffset -= Doc->currentPage()->yOffset();
        }
        setRulerPos(contentsX(), contentsY());
        m_canvas->newRedrawPolygon();
        int docSelectionCount=Doc->m_Selection->count();
        if (docSelectionCount != 0)
        {
                if (docSelectionCount > 1)
                {
                        double x, y, w, h;
                        Doc->m_Selection->getGroupRect(&x, &y, &w, &h);
                        emit ItemGeom();
                }
                else
                        Doc->m_Selection->itemAt(0)->emitAllToGUI();
        }
}

void ScribusView::editExtendedImageProperties()
{
        if (Doc->m_Selection->count() != 0)
        {
                PageItem *currItem = Doc->m_Selection->itemAt(0);
                if (currItem->pixm.imgInfo.valid)
                {
                        ExtImageProps* dia = new ExtImageProps(this, &currItem->pixm.imgInfo, currItem, this);
                        dia->exec();
                        delete dia;
                        dia=NULL;
                        m_ScMW->propertiesPalette->setTextFlowMode(currItem->textFlowMode());
                }
        }
}

void ScribusView::ToPicFrame()
{
        Selection tempSelection(*Doc->m_Selection);
        Doc->m_Selection->delaySignalsOn();
        updatesOn(false);
        Deselect(true);
        Selection restoreSelection(this);
        Doc->itemSelection_convertItemsTo(PageItem::ImageFrame, &restoreSelection, &tempSelection);
        Doc->m_Selection->copy(restoreSelection, true);
        updatesOn(true);
        Doc->m_Selection->delaySignalsOff();
}

void ScribusView::ToPolyFrame()
{
        Selection tempSelection(*Doc->m_Selection);
        Doc->m_Selection->delaySignalsOn();
        updatesOn(false);
        Deselect(true);
        Selection restoreSelection(this);
        Doc->itemSelection_convertItemsTo(PageItem::Polygon, &restoreSelection, &tempSelection);
        Doc->m_Selection->copy(restoreSelection, true);
        updatesOn(true);
        Doc->m_Selection->delaySignalsOff();
}

void ScribusView::ToTextFrame()
{
        Selection tempSelection(*Doc->m_Selection);
        Doc->m_Selection->delaySignalsOn();
        updatesOn(false);
        Deselect(true);
        Selection restoreSelection(this);
        Doc->itemSelection_convertItemsTo(PageItem::TextFrame, &restoreSelection, &tempSelection);
        Doc->m_Selection->copy(restoreSelection, true);
        updatesOn(true);
        Doc->m_Selection->delaySignalsOff();
}

void ScribusView::ToBezierFrame()
{
        Selection tempSelection(*Doc->m_Selection);
        Doc->m_Selection->delaySignalsOn();
        updatesOn(false);
        Deselect(true);
        Selection restoreSelection(this);
        Doc->itemSelection_convertItemsTo(PageItem::PolyLine, &restoreSelection, &tempSelection);
        Doc->m_Selection->copy(restoreSelection, true);
        updatesOn(true);
        Doc->m_Selection->delaySignalsOff();
}

void ScribusView::Bezier2Poly()
{
        Selection tempSelection(*Doc->m_Selection);
        Doc->m_Selection->delaySignalsOn();
        updatesOn(false);
        Deselect(true);
        Selection restoreSelection(this);
        Doc->itemSelection_convertItemsTo(PageItem::Polygon, &restoreSelection, &tempSelection);
        Doc->m_Selection->copy(restoreSelection, true);
        updatesOn(true);
        Doc->m_Selection->delaySignalsOff();
}

void ScribusView::ToPathText()
{
        if (Doc->m_Selection->count() > 1)
        {
                PageItem* currItem=Doc->m_Selection->itemAt(0);
                PageItem *polyLineItem;
                if (currItem->asTextFrame())
                        polyLineItem=Doc->m_Selection->itemAt(1);
                else
                {
                        polyLineItem=Doc->m_Selection->itemAt(0);
                        currItem=Doc->m_Selection->itemAt(1);
                }
                ParagraphStyle dstyle(currItem->itemText.defaultStyle());
                if (polyLineItem->asPolyLine() || polyLineItem->asPolygon())
                {
                        Deselect(true);
                        PageItem* newItem=Doc->convertItemTo(currItem, PageItem::PathText, polyLineItem);
                        newItem->itemText.setDefaultStyle(dstyle);
                        newItem->itemText.applyCharStyle(0, newItem->itemText.length(), dstyle.charStyle());
                        newItem->invalid = true;
                        newItem->update();
                        SelectItem(newItem);
                        emit DocChanged();
                }
        }
}

void ScribusView::FromPathText()
{
        PageItem *currItem;
        if (Doc->getItem(&currItem))
        {
                Deselect(true);
                PageItem* newItem=Doc->convertItemTo(currItem, PageItem::TextFrame);
                SelectItem(newItem);
                Doc->bringItemSelectionToFront();
                update();
        }
}

// FIXME: the following code is untested, but it should give an idea for
// anyone who wants to fix and knows how to test it.
class TextToPathPainter: public TextLayoutPainter
{
        ScribusView* m_view;
        PageItem* m_item;
        QList<PageItem*> m_group;
        int m_counter;

public:
        TextToPathPainter(ScribusView* view, PageItem* item)
                : m_view(view)
                , m_item(item)
                , m_counter(0)
        {}

        void drawGlyph(const GlyphLayout gl)
        {

                FPointArray outline = font().glyphOutline(gl.glyph);
                if (outline.size() < 4)
                        return;
                QTransform transform = matrix();
                transform.scale(x(), y());
                outline.map(transform);
                uint z = m_view->Doc->itemAdd(PageItem::Polygon, PageItem::Unspecified, m_item->xPos(), m_item->yPos(), m_item->width(), m_item->height(), m_item->lineWidth(), m_item->lineColor(), m_item->fillColor());
                PageItem* item = m_view->Doc->Items->at(z);
                m_view->undoManager->setUndoEnabled(false);
                item->setTextFlowMode(m_item->textFlowMode());
                item->setSizeLocked(m_item->sizeLocked());
                item->setLocked(m_item->locked());
                item->NamedLStyle = m_item->NamedLStyle;
                item->setItemName(m_item->itemName() + "+U" + QString::number(m_counter++));
                item->PoLine = outline.copy();
                if (!m_item->asPathText())
                        item->setRotation(m_item->rotation());
                item->setFillColor(fillColor().color);
                item->setFillShade(fillColor().shade);
                item->setLineWidth(strokeWidth());
                m_view->Doc->adjustItemSize(item);
                item->ContourLine = item->PoLine.copy();
                item->ClipEdited = true;
                item->FrameType = 3;
                item->OldB2 = item->width();
                item->OldH2 = item->height();
                m_view->Doc->setRedrawBounding(item);
                m_view->undoManager->setUndoEnabled(true);
                m_group.append(m_view->Doc->Items->takeAt(z));
        }
        void drawGlyphOutline(const GlyphLayout gl, bool fill)
        {
                drawGlyph(gl);
        }
        void drawLine(QPointF start, QPointF end)
        {
                QTransform transform = matrix();
                transform.translate(x(), y());
                uint z = m_view->Doc->itemAdd(PageItem::PolyLine, PageItem::Unspecified, m_item->xPos(), m_item->yPos(), m_item->width(), m_item->height(), m_item->lineWidth(), m_item->lineColor(), m_item->fillColor());
                PageItem* item = m_view->Doc->Items->at(z);
                m_view->undoManager->setUndoEnabled(false);
                item->setTextFlowMode(m_item->textFlowMode());
                item->setSizeLocked(m_item->sizeLocked());
                item->setLocked(m_item->locked());
                item->NamedLStyle = m_item->NamedLStyle;
                item->setItemName(m_item->itemName() + "+U" + QString::number(m_counter++));
                item->PoLine.resize(0);
                item->PoLine.addQuadPoint(FPoint(start), FPoint(start), FPoint(end), FPoint(end));
                item->PoLine.map(transform);
                item->setLineColor(fillColor().color);
                item->setLineShade(fillColor().shade);
                item->setLineWidth(strokeWidth());
                m_view->Doc->adjustItemSize(item);
                item->ContourLine = item->PoLine.copy();
                item->ClipEdited = true;
                item->FrameType = 3;
                item->OldB2 = item->width();
                item->OldH2 = item->height();
                m_view->Doc->setRedrawBounding(item);
                m_view->undoManager->setUndoEnabled(true);
                m_group.append(m_view->Doc->Items->takeAt(z));
        }
        void drawRect(QRectF rect) {}
        void drawObject(PageItem* item) {}
};

void ScribusView::TextToPath()
{
        if (Doc->appMode == modeEditClip)
                requestMode(submodeEndNodeEdit);
        Selection tmpSelection(this, false);
        tmpSelection.copy(*Doc->m_Selection, false);
        PageItem *currItem = tmpSelection.itemAt(0);
        if ((currItem->prevInChain() != 0) || (currItem->nextInChain() != 0))
        {
                // select whole chain
                PageItem *backItem = currItem;
                while (backItem->prevInChain() != 0)
                        backItem = backItem->prevInChain();
                currItem = backItem;
                Deselect(true);
                tmpSelection.addItem(currItem);
                backItem = currItem->nextInChain();
                while (backItem != 0)
                {
                        tmpSelection.addItem(backItem);
                        if (backItem->nextInChain() != 0)
                                backItem = backItem->nextInChain();
                        else
                                break;
                }
        }
        QList<PageItem*> delItems,newGroupedItems;
        newGroupedItems.clear();
        uint selectedItemCount = tmpSelection.count();
        if (selectedItemCount != 0)
        {
                UndoTransaction trans(undoManager->beginTransaction(currItem->getUName(), currItem->getUPixmap(), Um::ToOutlines, "", 0));
                uint offset=0;
                for(uint i=0; i<selectedItemCount; ++i)
                {
                        PageItem *currItem = tmpSelection.itemAt(offset);
                        bool cont=false;
                        if ((!((currItem->asTextFrame()) || (currItem->asPathText()))) || (currItem->locked()) || currItem->itemText.length() == 0)
                                cont=true;
                        if (currItem==m_ScMW->storyEditor->currentItem() && Doc==m_ScMW->storyEditor->currentDocument())
                        {
                                ScMessageBox::information(m_ScMW, tr("Cannot Convert In-Use Item"), "<qt>" + tr("The item %1 is currently being edited by Story Editor. The convert to outlines operation for this item will be skipped").arg(currItem->itemName()) + "</qt>");
                                cont=true;
                        }
                        //Deselect();
                        if (cont)
                        {
                                ++offset;
                                continue;
                        }

                        TextToPathPainter p(this, currItem);
                        currItem->textLayout.render(&p);
                        if ((currItem->asPathText()) && (currItem->PoShow))
                        {
                                uint z = Doc->itemAdd(PageItem::PolyLine, PageItem::Unspecified, currItem->xPos(), currItem->yPos(), currItem->width(), currItem->height(), currItem->lineWidth(), CommonStrings::None, currItem->lineColor());
                                PageItem *bb = Doc->Items->at(z);
                                undoManager->setUndoEnabled(false);
                                bb->PoLine = currItem->PoLine.copy();
                                bb->ClipEdited = true;
                                bb->FrameType = 3;
                                bb->OldB2 = bb->width();
                                bb->OldH2 = bb->height();
                                bb->setRotation(currItem->rotation());
                                Doc->adjustItemSize(bb);
                                undoManager->setUndoEnabled(true);
                                newGroupedItems.append(Doc->Items->takeAt(z));
                        }
                        if (currItem->asTextFrame())
                        {
                                if ((!currItem->NamedLStyle.isEmpty()) || (currItem->lineColor() != CommonStrings::None) || (!currItem->strokePattern().isEmpty()) || (!currItem->strokeGradient().isEmpty()))
                                {
                                        PageItem* newItem = new PageItem_Polygon(*currItem);
                                        newItem->convertTo(PageItem::Polygon);
                                        newItem->ClipEdited = true;
                                        newItem->FrameType = 3;
                                        newItem->OldB2 = newItem->width();
                                        newItem->OldH2 = newItem->height();
                                        newItem->Clip = FlattenPath(newItem->PoLine, newItem->Segments);
                                        newItem->ContourLine = newItem->PoLine.copy();
                                        newGroupedItems.prepend(newItem);
                                }
                        }
                        delItems.append(tmpSelection.takeItem(offset));
                }
                tmpSelection.clear();
                int ind = -1;
                if (currItem->isGroupChild())
                        ind = currItem->parentGroup()->groupItemList.indexOf(currItem);
                else
                        ind = Doc->Items->indexOf(currItem);
                if (newGroupedItems.count() > 1)
                {
                        double minx =  std::numeric_limits<double>::max();
                        double miny =  std::numeric_limits<double>::max();
                        double maxx = -std::numeric_limits<double>::max();
                        double maxy = -std::numeric_limits<double>::max();
                        for (int ep = 0; ep < newGroupedItems.count(); ++ep)
                        {
                                double x1, x2, y1, y2;
                                newGroupedItems.at(ep)->getVisualBoundingRect(&x1, &y1, &x2, &y2);
                                minx = qMin(minx, x1);
                                miny = qMin(miny, y1);
                                maxx = qMax(maxx, x2);
                                maxy = qMax(maxy, y2);
                        }
                        double gx = minx;
                        double gy = miny;
                        double gw = maxx - minx;
                        double gh = maxy - miny;
                        int z = Doc->itemAdd(PageItem::Group, PageItem::Rectangle, gx, gy, gw, gh, 0, CommonStrings::None, CommonStrings::None);
                        PageItem *gItem = Doc->Items->takeAt(z);
                        Doc->groupObjectsToItem(gItem, newGroupedItems);
                        gItem->Parent = currItem->Parent;
                        gItem->gXpos = currItem->gXpos;
                        gItem->gYpos = currItem->gYpos;
                        if (currItem->isGroupChild())
                                currItem->parentGroup()->groupItemList.insert(ind+1, gItem);
                        else
                                Doc->Items->insert(ind+1, gItem);
                }
                else if (newGroupedItems.count() > 0)
                {
                        newGroupedItems.at(0)->Parent = currItem->Parent;
                        if (currItem->isGroupChild())
                                currItem->parentGroup()->groupItemList.insert(ind+1, newGroupedItems.at(0));
                        else
                                Doc->Items->insert(ind+1, newGroupedItems.at(0));
                }
                int toDeleteItemCount=delItems.count();
                if (toDeleteItemCount != 0)
                {
                        tmpSelection.clear();
                        for(int i=0; i<toDeleteItemCount; ++i)
                                tmpSelection.addItem(delItems.takeAt(0)); //yes, 0, remove the first
                        Doc->itemSelection_DeleteItem(&tmpSelection);
                }
                m_ScMW->HaveNewSel();
                Deselect(true);
                trans.commit();
        }
}

void ScribusView::keyPressEvent(QKeyEvent *k)
{
        if (m_canvasMode && m_canvasMode->handleKeyEvents())
                m_canvasMode->keyPressEvent(k);
        else
                m_ScMW->keyPressEvent(k);
}

void ScribusView::keyReleaseEvent(QKeyEvent *k)
{
        m_ScMW->keyReleaseEvent(k);
}

void ScribusView::inputMethodEvent ( QInputMethodEvent * event )
{
        //qDebug() << "IME" << event->commitString() << event->preeditString() << "attributes:" << event->attributes().count();
        // #9682 : Avoid parameter type ambiguity in QKeyEvent constructor with Qt3Support enabled Qt builds
        Qt::KeyboardModifiers modifiers = Qt::NoModifier;
        for(int i = 0; i < event->commitString().length(); ++i)
        {
                QKeyEvent ev( QEvent::KeyPress, 0, modifiers, event->commitString().mid(i,1));
                keyPressEvent(&ev);
        }
}

QVariant ScribusView::inputMethodQuery ( Qt::InputMethodQuery query ) const
{
//      qDebug() << "IMQ" << query;
        return QVariant();
}

void ScribusView::wheelEvent(QWheelEvent *w)
{
        if (w->modifiers() == Qt::ControlModifier)
        {
                FPoint mp = m_canvas->globalToCanvas(w->globalPos());
                w->delta() > 0 ? slotZoomIn(mp.x(), mp.y()) : slotZoomOut(mp.x(), mp.y());
               
        }
        else
        {
                int dX=0,dY=0;
                int moveBy=(w->delta() < 0) ? Prefs->uiPrefs.wheelJump : -Prefs->uiPrefs.wheelJump;
                if ((w->orientation() != Qt::Vertical) || ( w->modifiers() == Qt::ShiftModifier ))
                        dX = moveBy;
                else
                        dY = moveBy;
                scrollBy(dX, dY);
        }
        w->accept();
}

void ScribusView::setObjectUndoMode()
{
        _isGlobalMode = undoManager->isGlobalMode();
        if (m_ScMW->HaveDoc)
        {
                //qDebug(QString("%1 %2").arg((int)m_ScMW).arg(m_ScMW->scrActions.contains("editActionMode")));
                m_ScMW->scrActions["editActionMode"]->setChecked(true);
                uint docSelectionCount=Doc->m_Selection->count();
                if (docSelectionCount == 1)
                        undoManager->showObject(Doc->m_Selection->itemAt(0)->getUId());
                else if (docSelectionCount > 1)
                        undoManager->showObject(Um::NO_UNDO_STACK);
                else if (docSelectionCount == 0)
                        undoManager->showObject(Doc->currentPage()->getUId());
        }
}

void ScribusView::setGlobalUndoMode()
{
        if (m_ScMW->HaveDoc)
        {
                m_ScMW->scrActions["editActionMode"]->setChecked(!_isGlobalMode);
                if (_isGlobalMode)
                        undoManager->showObject(Um::GLOBAL_UNDO_MODE);
                else
                {
                        uint docSelectionCount=Doc->m_Selection->count();
                        if (docSelectionCount == 1)
                                undoManager->showObject(Doc->m_Selection->itemAt(0)->getUId());
                        else if (docSelectionCount > 1)
                                undoManager->showObject(Um::NO_UNDO_STACK);
                        else if (docSelectionCount == 0)
                                undoManager->showObject(Doc->currentPage()->getUId());
                }
        }
}

void ScribusView::unitChange()
{
        vertRuler->unitChange();
        horizRuler->unitChange();
}

void ScribusView::setRulersShown(bool isShown)
{
        vertRuler->setVisible(isShown);
        horizRuler->setVisible(isShown);
        rulerMover->setVisible(isShown);
        int newTopLeftMargin = isShown ? m_vhRulerHW : 0;
        setViewportMargins(newTopLeftMargin, newTopLeftMargin, 0, 0);
}

void ScribusView::setScale(const double newScale)
{
        double Scale=newScale;
        double v=Doc->opToolPrefs().magMin*Prefs->displayPrefs.displayScale/100.0;
        if (Scale < v)
                Scale=v;
        double v2=Doc->opToolPrefs().magMax*Prefs->displayPrefs.displayScale/100.0;
        if (Scale > v2)
                Scale=v2;
        double v3=320*Prefs->displayPrefs.displayScale;
        if (Scale > v3)
                Scale=v3;

        m_canvas->setScale(Scale);

        m_ScMW->zoomSpinBox->blockSignals(true);
        m_ScMW->zoomSpinBox->setValue(m_canvas->scale()/Prefs->displayPrefs.displayScale*100);
        m_ScMW->zoomSpinBox->blockSignals(false);

        unitChange();
}



double ScribusView::scale() const
{
        return m_canvas->scale();
}

bool ScribusView::eventFilter(QObject *obj, QEvent *event)
{
//      if (obj == horizRuler || obj == vertRuler || obj == rulerMover)
//              return true; // FIXME:av

        if (obj == widget() && event->type() == QEvent::MouseMove)
        {
                QMouseEvent* m = static_cast<QMouseEvent*> (event);
                m_mousePointDoc=m_canvas->globalToCanvas(m->globalPos());
                FPoint p = m_canvas->localToCanvas(QPoint(m->x(),m->y()));
                emit MousePos(p.x(),p.y());
                horizRuler->Draw(m->x() + qRound(Doc->minCanvasCoordinate.x() * m_canvas->scale())); //  - 2 * contentsX());
                vertRuler->Draw(m->y() + qRound(Doc->minCanvasCoordinate.y() * m_canvas->scale()));
                m_canvasMode->mouseMoveEvent(m);
                return true;
        }
        else if (obj == widget() && event->type() == QEvent::MouseButtonRelease)
        {
                QMouseEvent* m = static_cast<QMouseEvent*> (event);
                m_canvasMode->mouseReleaseEvent(m);
                m_canvas->m_viewMode.m_MouseButtonPressed = false;
                if (linkAfterDraw)
                {
                        //user creates new frame using linking tool
                        PageItem * secondFrame = Doc->m_Selection->itemAt(0);
                        if (secondFrame && firstFrame)
                        {
                                firstFrame->link(secondFrame);
                                firstFrame = NULL;
                        }
                        linkAfterDraw = false;
                }
                if (ImageAfterDraw)
                {
                        //user creates new frame using linking tool
                        PageItem * frame = Doc->m_Selection->itemAt(0);
                        requestMode(modeImportImage);
                        if (frame)
                        {
                                dynamic_cast<CanvasMode_ImageImport*>(canvasMode())->setImage(frame);
                                dynamic_cast<CanvasMode_ImageImport*>(canvasMode())->updateList();
                        }
                        ImageAfterDraw = false;
                }
                return true;
        }
        else if (obj == widget() && event->type() == QEvent::MouseButtonPress)
        {
                QMouseEvent* m = static_cast<QMouseEvent*> (event);
                bool linkmode = (Doc->appMode == modeLinkFrames);
                firstFrame = Doc->m_Selection->itemAt(0);
                m_canvasMode->mousePressEvent(m);
                //if user don't click any frame he want to draw new frame and link it
                bool requestDrawMode = (Doc->ElemToLink == NULL);
                if (linkmode && requestDrawMode)
                {
                        //switch to drawing new text frame
                        linkAfterDraw = true;
                        requestMode(modeDrawText);
                        m_canvasMode->mousePressEvent(m);
                }
                else
                        firstFrame = NULL;
                if(Doc->appMode == modeImportImage && ImageAfterDraw)
                {
                        //switch to drawing new text frame
                        requestMode(modeDrawImage);
                        m_canvasMode->mousePressEvent(m);
                }
                m_canvas->m_viewMode.m_MouseButtonPressed = true;
                return true;
        }
        else if (obj == widget() && event->type() == QEvent::MouseButtonDblClick)
        {
                QMouseEvent* m = static_cast<QMouseEvent*> (event);
                m_canvasMode->mouseDoubleClickEvent(m);
                return true;
        }
        else if (event->type() == QEvent::KeyPress)
        {
                QKeyEvent* m = static_cast<QKeyEvent*> (event);
                /* #12453... what do we use this for?
                 if(m->key() == Qt::Key_Shift)
                {
                        m_oldSnapToElem = Doc->SnapElement;
                        m_ScMW->SetSnapElements(false);
                }
                */

                if (m_canvasMode->handleKeyEvents())
                        m_canvasMode->keyPressEvent(m);
                else
                        m_ScMW->keyPressEvent(m);
                return true;
        }
        else if (event->type() == QEvent::KeyRelease)
        {
                QKeyEvent* m = static_cast<QKeyEvent*> (event);
                /* #12453... what do we use this for?
                if(m->key() == Qt::Key_Shift)
                        m_ScMW->SetSnapElements(m_oldSnapToElem);
                */

                if (m_canvasMode->handleKeyEvents())
                        m_canvasMode->keyReleaseEvent(m);
                else
                        m_ScMW->keyReleaseEvent(m);
                return true;
        }
        else if (obj == widget() && event->type() == QEvent::DragEnter)
        {
                QDragEnterEvent* d = static_cast<QDragEnterEvent*> (event);
                contentsDragEnterEvent(d);
                return true;
        }
        else if (obj == widget() && event->type() == QEvent::DragLeave)
        {
                QDragLeaveEvent* d = static_cast<QDragLeaveEvent*> (event);
                contentsDragLeaveEvent(d);
                return true;
        }
        else if (obj == widget() && event->type() == QEvent::DragMove)
        {
                QDragMoveEvent* d = static_cast<QDragMoveEvent*> (event);
                contentsDragMoveEvent(d);
                return true;
        }
        else if (obj == widget() && event->type() == QEvent::Drop)
        {
                QDropEvent* d = static_cast<QDropEvent*> (event);
                contentsDropEvent(d);
                return true;
        }

        // rulermover events
        // hruler events
        // vruler events

        return QScrollArea::eventFilter(obj, event);
}

//Legacy

void ScribusView::updateContents(QRect box)
{
        if (box.isValid())
                m_canvas->update(box);
        else
                m_canvas->update();
}

void ScribusView::updateContents(int x, int y, int w, int h)
{
        updateContents(QRect(x,y,w,h));
}

void ScribusView::repaintContents(QRect box)
{
        if (box.isValid())
                m_canvas->repaint(box);
        else
                m_canvas->repaint();
}

void ScribusView::resizeContents(int w, int h)  // deprecated
{
//      qDebug() << "ScribusView::resizeContents(" << w << "," << h << ")";
        int originX = qRound(Doc->minCanvasCoordinate.x() * scale());
        int originY = qRound(Doc->minCanvasCoordinate.y() * scale());
        widget()->resize(w - 0*originX, h - 0*originY);
}

QPoint ScribusView::contentsToViewport(QPoint p) // deprecated
{
        return p + viewport()->pos();
}

QPoint ScribusView::viewportToContents(QPoint p) // deprecated
{
        return p - viewport()->pos();
}

int ScribusView::contentsX() // deprecated
{
        int originX = qRound(Doc->minCanvasCoordinate.x() * scale());
        return horizontalScrollBar()->value() + originX;
}

int ScribusView::contentsY() // deprecated
{
        int originY = qRound(Doc->minCanvasCoordinate.y() * scale());
        return verticalScrollBar()->value() + originY;
}

int ScribusView::contentsWidth()
{
        return horizontalScrollBar()->maximum() - horizontalScrollBar()->minimum();
}

int ScribusView::contentsHeight()
{
        return verticalScrollBar()->maximum() - verticalScrollBar()->minimum();
}

void ScribusView::setContentsPos(int x, int y)
{
        horizontalScrollBar()->setValue(x);
        verticalScrollBar()->setValue(y);
        setRulerPos(contentsX(), contentsY());
}


void ScribusView::scrollContentsBy(int dx, int dy)
{
        QScrollArea::scrollContentsBy (dx, dy);
        setRulerPos(contentsX(), contentsY());
}

void ScribusView::scrollBy(int x, int y) // deprecated
{
        setContentsPos(horizontalScrollBar()->value() + x, verticalScrollBar()->value() + y);
}

void ScribusView::zoom(double scale)
{
        double zPointX = oldX, zPointY = oldY;
        if (scale <= 0.0)
                scale = m_canvas->scale();
        if (Doc->m_Selection->count() != 0)
        {
                PageItem *currItem = Doc->m_Selection->itemAt(0);
                zPointX = currItem->xPos() + currItem->width() / 2.0;
                zPointY = currItem->yPos() + currItem->height() / 2.0;
        }
        zoom( qRound(zPointX), qRound(zPointY), scale, false);
}

void ScribusView::zoom(int canvasX, int canvasY, double scale, bool preservePoint)
{
        QPoint globalPoint = m_canvas->canvasToGlobal(QPointF(canvasX, canvasY));
        double newScale = (scale > (Prefs->opToolPrefs.magMax / 100) * Prefs->displayPrefs.displayScale) ? ((Prefs->opToolPrefs.magMax / 100) * Prefs->displayPrefs.displayScale) : scale;
        undoManager->setUndoEnabled(false);
        updatesOn(false);
        setScale(newScale);
        QPoint localPoint = m_canvas->canvasToLocal( QPointF(canvasX, canvasY) );
        int nw = qMax(qRound((Doc->maxCanvasCoordinate.x() - Doc->minCanvasCoordinate.x()) * m_canvas->scale()), visibleWidth());
        int nh = qMax(qRound((Doc->maxCanvasCoordinate.y() - Doc->minCanvasCoordinate.y()) * m_canvas->scale()), visibleHeight());
        resizeContents(nw, nh); // FIXME : should be avoided here, cause an unnecessary paintEvent despite updates disabled
        QPoint canvasPoint;
        if (preservePoint)
                canvasPoint = viewport()->mapFromGlobal(globalPoint);
        else
                canvasPoint = QPoint(viewport()->width() / 2, viewport()->height() / 2);
        setContentsPos(localPoint.x() - canvasPoint.x(), localPoint.y() - canvasPoint.y());
        updatesOn(true);
        undoManager->setUndoEnabled(true);
}


void ScribusView::stopAllDrags() // deprecated
{
        m_canvas->m_viewMode.m_MouseButtonPressed = false;
        m_canvas->m_viewMode.operItemMoving = false;
        m_canvas->m_viewMode.operItemResizing = false;
        MidButt = false;
}

void ScribusView::setRedrawMarkerShown(bool shown)
{
        if (shown!=redrawMarker->isVisible())
                redrawMarker->setVisible(shown);
}